(2S,4aR,5R,8aR)-1,1,4a-trimethyl-6-methylidene-5-(4-methylpent-3-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol
| Internal ID | 81686f1d-91e5-48b9-9a85-95c950f966b5 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Cyclic alcohols and derivatives |
| IUPAC Name | (2S,4aR,5R,8aR)-1,1,4a-trimethyl-6-methylidene-5-(4-methylpent-3-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES (Canonical) | CC(=CCCC1C(=C)CCC2C1(CCC(C2(C)C)O)C)C |
| SMILES (Isomeric) | CC(=CCC[C@@H]1C(=C)CC[C@@H]2[C@@]1(CC[C@@H](C2(C)C)O)C)C |
| InChI | InChI=1S/C20H34O/c1-14(2)8-7-9-16-15(3)10-11-17-19(4,5)18(21)12-13-20(16,17)6/h8,16-18,21H,3,7,9-13H2,1-2,4-6H3/t16-,17+,18+,20-/m1/s1 |
| InChI Key | SWJDLCQNNNRLCD-DOADOZAASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.260965704 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.95% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.22% | 90.17% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 92.62% | 95.93% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 90.95% | 99.43% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.13% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.52% | 94.45% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.04% | 95.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.72% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.12% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.61% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.65% | 95.89% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.09% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nassauvia argentea |
| PubChem | 162917406 |
| LOTUS | LTS0121469 |
| wikiData | Q105262712 |