4,7-Dihydroxy-4-(hydroxymethyl)-5,6,7-trimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione
Internal ID | 777220d1-2963-4776-afcf-4fec530bd4f4 |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | 4,7-dihydroxy-4-(hydroxymethyl)-5,6,7-trimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione |
SMILES (Canonical) | CC1C(C(C(=O)OC2CCN3C2C(=CC3)COC(=O)C1(C)O)(CO)O)C |
SMILES (Isomeric) | CC1C(C(C(=O)OC2CCN3C2C(=CC3)COC(=O)C1(C)O)(CO)O)C |
InChI | InChI=1S/C18H27NO7/c1-10-11(2)18(24,9-20)16(22)26-13-5-7-19-6-4-12(14(13)19)8-25-15(21)17(10,3)23/h4,10-11,13-14,20,23-24H,5-9H2,1-3H3 |
InChI Key | KWEQCWXCFQWUQU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H27NO7 |
Molecular Weight | 369.40 g/mol |
Exact Mass | 369.17875220 g/mol |
Topological Polar Surface Area (TPSA) | 117.00 Ų |
XlogP | -0.10 |
6190-25-6 |
![2D Structure of 4,7-Dihydroxy-4-(hydroxymethyl)-5,6,7-trimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione 2D Structure of 4,7-Dihydroxy-4-(hydroxymethyl)-5,6,7-trimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione](https://plantaedb.com/storage/docs/compounds/2023/11/e27a2420-85cb-11ee-a347-272e83f2e965.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.77% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.12% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.28% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.21% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.11% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.19% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.80% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.38% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.33% | 97.09% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.19% | 95.83% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.51% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.35% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.34% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio latifolius |
PubChem | 53462821 |
LOTUS | LTS0085668 |
wikiData | Q105146893 |