[(1S,3R,6S,7S,8S,11S,12S,15R,16R)-7,12,16-trimethyl-15-[(2R,5S)-6-methyl-5-propan-2-ylhept-6-en-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate
Internal ID | 285d7c30-07c3-4cb5-94bc-afaf67360d43 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | [(1S,3R,6S,7S,8S,11S,12S,15R,16R)-7,12,16-trimethyl-15-[(2R,5S)-6-methyl-5-propan-2-ylhept-6-en-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
SMILES (Canonical) | CC1C2CCC3C4(CCC(C4(CCC35C2(C5)CCC1OC(=O)C)C)C(C)CCC(C(C)C)C(=C)C)C |
SMILES (Isomeric) | C[C@H]1[C@@H]2CC[C@H]3[C@@]4(CC[C@@H]([C@]4(CC[C@@]35[C@@]2(C5)CC[C@@H]1OC(=O)C)C)[C@H](C)CC[C@@H](C(C)C)C(=C)C)C |
InChI | InChI=1S/C34H56O2/c1-21(2)26(22(3)4)11-10-23(5)27-14-16-32(9)30-13-12-28-24(6)29(36-25(7)35)15-17-33(28)20-34(30,33)19-18-31(27,32)8/h22-24,26-30H,1,10-20H2,2-9H3/t23-,24+,26-,27-,28+,29+,30+,31-,32+,33-,34+/m1/s1 |
InChI Key | CFCDWJUKFDUOGZ-XVAZYWPBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H56O2 |
Molecular Weight | 496.80 g/mol |
Exact Mass | 496.42803102 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 11.40 |
There are no found synonyms. |
![2D Structure of [(1S,3R,6S,7S,8S,11S,12S,15R,16R)-7,12,16-trimethyl-15-[(2R,5S)-6-methyl-5-propan-2-ylhept-6-en-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate 2D Structure of [(1S,3R,6S,7S,8S,11S,12S,15R,16R)-7,12,16-trimethyl-15-[(2R,5S)-6-methyl-5-propan-2-ylhept-6-en-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/e231a3e0-85bb-11ee-9519-814eab7c62cc.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.27% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.79% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.28% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.63% | 98.95% |
CHEMBL233 | P35372 | Mu opioid receptor | 92.57% | 97.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.46% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.20% | 91.19% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.19% | 90.17% |
CHEMBL3837 | P07711 | Cathepsin L | 87.75% | 96.61% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.86% | 95.58% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.18% | 96.95% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.85% | 97.79% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.68% | 91.24% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.20% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.11% | 96.38% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.44% | 89.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.43% | 97.09% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.70% | 93.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.61% | 95.89% |
CHEMBL4072 | P07858 | Cathepsin B | 83.18% | 93.67% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.35% | 95.71% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.32% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.20% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.72% | 82.69% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.96% | 96.09% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 80.54% | 99.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nervilia plicata |
PubChem | 23258666 |
LOTUS | LTS0094800 |
wikiData | Q104956307 |