2-[5-[4,5-Dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-2-[7-(hydroxymethyl)-5',9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 08f3dfe4-6e1c-4f15-8de2-474a9a2729f2 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[5-[4,5-dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-2-[7-(hydroxymethyl)-5',9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)OC9C(C(C(CO9)O)O)O)O)OC2C(C(C(C(O2)C)O)O)O)C)C)CO)NC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)OC9C(C(C(CO9)O)O)O)O)OC2C(C(C(C(O2)C)O)O)O)C)C)CO)NC1 |
InChI | InChI=1S/C50H81NO20/c1-20-8-13-50(51-16-20)28(17-52)32-30(71-50)15-27-25-7-6-23-14-24(9-11-48(23,4)26(25)10-12-49(27,32)5)66-47-43(70-45-39(61)36(58)33(55)21(2)64-45)40(62)41(31(18-53)67-47)68-46-42(37(59)34(56)22(3)65-46)69-44-38(60)35(57)29(54)19-63-44/h6,20-22,24-47,51-62H,7-19H2,1-5H3 |
InChI Key | AAXCNACZLXEEAS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H81NO20 |
Molecular Weight | 1016.20 g/mol |
Exact Mass | 1015.53519397 g/mol |
Topological Polar Surface Area (TPSA) | 318.00 Ų |
XlogP | -1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.01% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.77% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.43% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.98% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.17% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.87% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.83% | 94.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.38% | 96.61% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.33% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.09% | 100.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 88.84% | 89.05% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.49% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.97% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.45% | 95.89% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.99% | 92.88% |
CHEMBL2581 | P07339 | Cathepsin D | 85.24% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.89% | 92.94% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.72% | 94.75% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.20% | 91.71% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.97% | 97.50% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.88% | 97.79% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.67% | 93.18% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.43% | 97.36% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.33% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.50% | 95.56% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 81.13% | 94.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.11% | 90.00% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.07% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum sycophanta |
PubChem | 163071524 |
LOTUS | LTS0033286 |
wikiData | Q104908416 |