3-hydroxy-3-[3-[5-hydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-(2-methylprop-1-enyl)oxolan-2-one
Internal ID | fd910f45-7fdb-4ca6-b291-c385ed6b0ff5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 3-hydroxy-3-[3-[5-hydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-(2-methylprop-1-enyl)oxolan-2-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C5CCC6C(CCC6(C5(CCC4C3(C)C)C)C)C7(CC(OC7=O)C=C(C)C)O)C)O)OC8C(C(C(CO8)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C5CCC6C(CCC6(C5(CCC4C3(C)C)C)C)C7(CC(OC7=O)C=C(C)C)O)C)O)OC8C(C(C(CO8)O)O)O)O)O)O |
InChI | InChI=1S/C46H74O16/c1-21(2)17-23-18-46(55,41(54)59-23)25-11-15-44(7)24(25)9-10-29-43(6)14-13-30(42(4,5)28(43)12-16-45(29,44)8)60-40-37(62-39-35(53)33(51)31(49)22(3)58-39)36(27(48)20-57-40)61-38-34(52)32(50)26(47)19-56-38/h17,22-40,47-53,55H,9-16,18-20H2,1-8H3 |
InChI Key | QQZPCWCERZJGPZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H74O16 |
Molecular Weight | 883.10 g/mol |
Exact Mass | 882.49768627 g/mol |
Topological Polar Surface Area (TPSA) | 244.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
![2D Structure of 3-hydroxy-3-[3-[5-hydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-(2-methylprop-1-enyl)oxolan-2-one 2D Structure of 3-hydroxy-3-[3-[5-hydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-(2-methylprop-1-enyl)oxolan-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/e1c93d30-8717-11ee-99a0-9b72d12b885c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.26% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.04% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.76% | 94.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.68% | 89.00% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 90.50% | 95.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.41% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.45% | 97.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.99% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.98% | 100.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.90% | 97.36% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.48% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.93% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.89% | 92.94% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.45% | 97.25% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.90% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 86.84% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.47% | 82.69% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.35% | 94.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.18% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.99% | 97.09% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.52% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gynostemma pentaphyllum |
PubChem | 72681264 |
LOTUS | LTS0132203 |
wikiData | Q105226168 |