7-[(2R,3R)-2,3-dihydroxy-4-[(2R,4R)-4-hydroxy-4-methyl-5-oxooxolan-2-yl]-3-methylbutoxy]chromen-2-one
| Internal ID | 140c330a-5d23-40cf-b5ff-29a2c0bb4147 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 7-[(2R,3R)-2,3-dihydroxy-4-[(2R,4R)-4-hydroxy-4-methyl-5-oxooxolan-2-yl]-3-methylbutoxy]chromen-2-one |
| SMILES (Canonical) | CC1(CC(OC1=O)CC(C)(C(COC2=CC3=C(C=C2)C=CC(=O)O3)O)O)O |
| SMILES (Isomeric) | C[C@]1(C[C@H](OC1=O)C[C@](C)([C@@H](COC2=CC3=C(C=C2)C=CC(=O)O3)O)O)O |
| InChI | InChI=1S/C19H22O8/c1-18(23,8-13-9-19(2,24)17(22)26-13)15(20)10-25-12-5-3-11-4-6-16(21)27-14(11)7-12/h3-7,13,15,20,23-24H,8-10H2,1-2H3/t13-,15-,18-,19-/m1/s1 |
| InChI Key | UFYRHTUTUIPRGG-SVYNMNNPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.13146766 g/mol |
| Topological Polar Surface Area (TPSA) | 123.00 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2039 | P27338 | Monoamine oxidase B | 99.01% | 92.51% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.25% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.61% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.06% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.95% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.24% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.46% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.83% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.45% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.49% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.49% | 94.45% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.08% | 93.18% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.04% | 95.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.65% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.67% | 89.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.53% | 86.92% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.24% | 95.89% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.16% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.63% | 99.23% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.36% | 92.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.51% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena excavata |
| PubChem | 162843497 |
| LOTUS | LTS0215225 |
| wikiData | Q105272210 |