11-Hydroxy-7,7,18,18-tetramethyl-2,8,19-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4(9),5,10,15(20),16,21-octaen-13-one
| Internal ID | a1dc29ae-b9e6-4232-b315-85b71cbbc7f8 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > Pyranoxanthones |
| IUPAC Name | 11-hydroxy-7,7,18,18-tetramethyl-2,8,19-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4(9),5,10,15(20),16,21-octaen-13-one |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC3=C2C(=O)C4=C(O3)C5=C(C=C4O)OC(C=C5)(C)C)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC3=C2C(=O)C4=C(O3)C5=C(C=C4O)OC(C=C5)(C)C)C |
| InChI | InChI=1S/C23H20O5/c1-22(2)9-7-12-15(27-22)5-6-16-18(12)20(25)19-14(24)11-17-13(21(19)26-16)8-10-23(3,4)28-17/h5-11,24H,1-4H3 |
| InChI Key | BELWAPDLROYTBA-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
![2D Structure of 11-Hydroxy-7,7,18,18-tetramethyl-2,8,19-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4(9),5,10,15(20),16,21-octaen-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/e11daf60-85eb-11ee-88bb-27f83141186e.jpg "2D Structure of 11-Hydroxy-7,7,18,18-tetramethyl-2,8,19-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4(9),5,10,15(20),16,21-octaen-13-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.13% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.70% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.67% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.34% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.35% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.76% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.18% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.47% | 86.33% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.25% | 95.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.35% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.98% | 90.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.58% | 91.49% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.54% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Maclura cochinchinensis |
| Maclura tricuspidata |
| PubChem | 14259061 |
| LOTUS | LTS0180043 |
| wikiData | Q104933141 |