(E)-N-methoxy-1-(4-methoxy-6-pyridin-2-ylpyridin-2-yl)methanimine
| Internal ID | ae9410d6-f299-4130-80a2-10ce9317e188 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Bipyridines and oligopyridines |
| IUPAC Name | (E)-N-methoxy-1-(4-methoxy-6-pyridin-2-ylpyridin-2-yl)methanimine |
| SMILES (Canonical) | COC1=CC(=NC(=C1)C2=CC=CC=N2)C=NOC |
| SMILES (Isomeric) | COC1=CC(=NC(=C1)C2=CC=CC=N2)/C=N/OC |
| InChI | InChI=1S/C13H13N3O2/c1-17-11-7-10(9-15-18-2)16-13(8-11)12-5-3-4-6-14-12/h3-9H,1-2H3/b15-9+ |
| InChI Key | WOCWELSPPBUMDA-OQLLNIDSSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.100776666 g/mol |
| Topological Polar Surface Area (TPSA) | 56.60 Ų |
| XlogP | 1.80 |
| SCHEMBL596977 |
| CHEMBL1823041 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 98.22% | 89.76% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.19% | 86.33% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 93.86% | 97.53% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.88% | 91.11% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.18% | 93.10% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.11% | 89.63% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.85% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.72% | 98.75% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 86.14% | 88.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.01% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.09% | 94.73% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.69% | 100.00% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 84.03% | 96.47% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.54% | 95.50% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.84% | 92.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.44% | 95.56% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 82.14% | 92.86% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 81.59% | 87.67% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.58% | 90.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.40% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.67% | 99.17% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.43% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16128661 |
| LOTUS | LTS0206463 |
| wikiData | Q105309429 |