(E)-calamenene
| Internal ID | d1f8f1b7-8fb4-4e2e-ab4e-11cc49d8abc0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1R,4S)-1,6-dimethyl-4-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
| SMILES (Canonical) | CC1CCC(C2=C1C=CC(=C2)C)C(C)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@H](C2=C1C=CC(=C2)C)C(C)C |
| InChI | InChI=1S/C15H22/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5,7,9-10,12-13H,6,8H2,1-4H3/t12-,13+/m1/s1 |
| InChI Key | PGTJIOWQJWHTJJ-OLZOCXBDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.33 g/mol |
| Exact Mass | 202.172150702 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 5.10 |
| (-)-trans-Calamenene |
| Calamenene, trans-(-)- |
| SUQ88Q1Q6F |
| Calamenene, trans-(+/-)- |
| 4H1Y6V04B0 |
| 73209-42-4 |
| Naphthalene, 1,2,3,4-tetrahydro-1,6-dimethyl-4-(1-methylethyl)-, (1R,4S)- |
| Naphthalene, 1,2,3,4-tetrahydro-1,6-dimethyl-4-(1-methylethyl)-, (1R,4S)-rel- |
| 35943-92-1 |
| UNII-SUQ88Q1Q6F |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.49% | 98.95% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 93.38% | 97.23% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 92.77% | 99.18% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.89% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.01% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.97% | 89.62% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.60% | 94.80% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.55% | 95.56% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.51% | 93.18% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 88.48% | 86.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.47% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.33% | 96.09% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 85.79% | 90.71% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 85.35% | 100.00% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 84.94% | 96.42% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.90% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.88% | 95.89% |
| CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 82.83% | 93.89% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.53% | 90.24% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.20% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.87% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.30% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cyperus alopecuroides |
| Cyperus rotundus |
| Juniperus communis |
| Juniperus foetidissima |
| Juniperus rigida |
| Leptospermum scoparium |
| Pilgerodendron uviferum |
| PubChem | 12302242 |
| LOTUS | LTS0158900 |
| wikiData | Q105208667 |