(E)-Arachidin II
| Internal ID | 1fc19036-3404-4972-88c2-2203322eeb73 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 5-[(Z)-2-(4-hydroxyphenyl)ethenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
| SMILES (Canonical) | CC(=CCC1=C(C=C(C=C1O)C=CC2=CC=C(C=C2)O)O)C |
| SMILES (Isomeric) | CC(=CCC1=C(C=C(C=C1O)/C=C\C2=CC=C(C=C2)O)O)C |
| InChI | InChI=1S/C19H20O3/c1-13(2)3-10-17-18(21)11-15(12-19(17)22)5-4-14-6-8-16(20)9-7-14/h3-9,11-12,20-22H,10H2,1-2H3/b5-4- |
| InChI Key | WWFOQQIWOKJBSJ-PLNGDYQASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.14124450 g/mol |
| Topological Polar Surface Area (TPSA) | 60.70 Ų |
| XlogP | 5.10 |
| Arachidin II |
| CHEBI:174824 |
| 4-Isopentenyl-3,4',5-trihydroxystilbene |
| 5-[(Z)-2-(4-hydroxyphenyl)ethenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.03% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.48% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.83% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.44% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.82% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 89.04% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.48% | 86.33% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 85.03% | 92.68% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.42% | 94.45% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.31% | 91.71% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.46% | 93.10% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.75% | 95.56% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.67% | 91.38% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 80.83% | 98.35% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.59% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arachis hypogaea |
| PubChem | 92012758 |
| LOTUS | LTS0148875 |
| wikiData | Q105313982 |