(E)-9,10,12,13,14,15-hexahydroxytetracos-17-enoic acid
| Internal ID | 8d53872d-49cc-4726-937b-ab0707cd84c8 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Very long-chain fatty acids |
| IUPAC Name | (E)-9,10,12,13,14,15-hexahydroxytetracos-17-enoic acid |
| SMILES (Canonical) | CCCCCCC=CCC(C(C(C(CC(C(CCCCCCCC(=O)O)O)O)O)O)O)O |
| SMILES (Isomeric) | CCCCCC/C=C/CC(C(C(C(CC(C(CCCCCCCC(=O)O)O)O)O)O)O)O |
| InChI | InChI=1S/C24H46O8/c1-2-3-4-5-6-8-12-15-19(26)23(31)24(32)21(28)17-20(27)18(25)14-11-9-7-10-13-16-22(29)30/h8,12,18-21,23-28,31-32H,2-7,9-11,13-17H2,1H3,(H,29,30)/b12-8+ |
| InChI Key | OXQUMQFOBXAJSP-XYOKQWHBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H46O8 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.31926842 g/mol |
| Topological Polar Surface Area (TPSA) | 159.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.51% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.17% | 98.95% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 95.54% | 85.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.26% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.11% | 89.63% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.63% | 97.29% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.53% | 92.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.14% | 93.56% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 91.38% | 97.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.86% | 90.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.61% | 100.00% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 89.05% | 96.00% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 87.31% | 92.26% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.14% | 93.31% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.08% | 96.47% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.09% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.83% | 91.11% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.98% | 100.00% |
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 82.28% | 97.34% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.77% | 96.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.15% | 92.50% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.90% | 91.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146682616 |
| LOTUS | LTS0098126 |
| wikiData | Q105202890 |