(E)-3,4,5-Trimethoxyphenylpropenyl angelate
Internal ID | 204aafcc-5ed7-4480-af42-faf2403279c1 |
Taxonomy | Benzenoids > Phenol ethers > Anisoles |
IUPAC Name | [(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enyl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OCC=CC1=CC(=C(C(=C1)OC)OC)OC |
SMILES (Isomeric) | C/C=C(/C)\C(=O)OC/C=C/C1=CC(=C(C(=C1)OC)OC)OC |
InChI | InChI=1S/C17H22O5/c1-6-12(2)17(18)22-9-7-8-13-10-14(19-3)16(21-5)15(11-13)20-4/h6-8,10-11H,9H2,1-5H3/b8-7+,12-6- |
InChI Key | RCHYRDLYWQUNHQ-OEVTXZRTSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C17H22O5 |
Molecular Weight | 306.40 g/mol |
Exact Mass | 306.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 54.00 Ų |
XlogP | 3.40 |
(E)-3,4,5-Trimethoxyphenylpropenyl angelate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.40% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.35% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.49% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.16% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.10% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.97% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.52% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.92% | 96.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.59% | 97.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.28% | 94.73% |
CHEMBL2535 | P11166 | Glucose transporter | 82.11% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligularia veitchiana |
PubChem | 46881362 |
LOTUS | LTS0121927 |
wikiData | Q105233637 |