(E)-3-methylsulfanyl-N-phenethylprop-2-enamide
Internal ID | 04ad5308-9144-4c37-9343-942f21f18908 |
Taxonomy | Benzenoids > Benzene and substituted derivatives |
IUPAC Name | (E)-3-methylsulfanyl-N-(2-phenylethyl)prop-2-enamide |
SMILES (Canonical) | CSC=CC(=O)NCCC1=CC=CC=C1 |
SMILES (Isomeric) | CS/C=C/C(=O)NCCC1=CC=CC=C1 |
InChI | InChI=1S/C12H15NOS/c1-15-10-8-12(14)13-9-7-11-5-3-2-4-6-11/h2-6,8,10H,7,9H2,1H3,(H,13,14)/b10-8+ |
InChI Key | INUPOERVCMJSKS-CSKARUKUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H15NOS |
Molecular Weight | 221.32 g/mol |
Exact Mass | 221.08743528 g/mol |
Topological Polar Surface Area (TPSA) | 54.40 Ų |
XlogP | 2.20 |
(2E)-3-(methylsulfanyl)-N-(2-phenylethyl)-2-propenamide |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.61% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.30% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.52% | 96.09% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 87.36% | 96.67% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.42% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.32% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.13% | 95.56% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 85.95% | 92.51% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.37% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.02% | 99.17% |
CHEMBL5028 | O14672 | ADAM10 | 84.19% | 97.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.07% | 95.50% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 82.14% | 89.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.86% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycosmis cyanocarpa |
PubChem | 10966074 |
LOTUS | LTS0080317 |
wikiData | Q105116411 |