(E)-3-(3-hydroxy-4-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]prop-2-enamide
| Internal ID | cc5f29a0-0bc3-482e-bf88-4eec3016334b |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | (E)-3-(3-hydroxy-4-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]prop-2-enamide |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C=CC(=O)NCCC2=CC(=C(C=C2)O)OC)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)/C=C/C(=O)NCCC2=CC(=C(C=C2)O)OC)O |
| InChI | InChI=1S/C19H21NO5/c1-24-17-7-4-13(11-16(17)22)5-8-19(23)20-10-9-14-3-6-15(21)18(12-14)25-2/h3-8,11-12,21-22H,9-10H2,1-2H3,(H,20,23)/b8-5+ |
| InChI Key | QGYGWYUQPCKNKZ-VMPITWQZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.14197277 g/mol |
| Topological Polar Surface Area (TPSA) | 88.00 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
![2D Structure of (E)-3-(3-hydroxy-4-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]prop-2-enamide](https://plantaedb.com/storage/docs/compounds/2023/11/e-3-3-hydroxy-4-methoxyphenyl-n-2-4-hydroxy-3-methoxyphenylethylprop-2-enamide.jpg "2D Structure of (E)-3-(3-hydroxy-4-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]prop-2-enamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.06% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.65% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.71% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.80% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.73% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.72% | 96.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.31% | 90.20% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.43% | 98.75% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 88.07% | 89.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.82% | 90.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.67% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.25% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.90% | 90.71% |
| CHEMBL3194 | P02766 | Transthyretin | 83.79% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.72% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.44% | 89.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 82.38% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chenopodium album |
| PubChem | 14412558 |
| LOTUS | LTS0101192 |
| wikiData | Q105220767 |