(E)-2-(non-2-en-1-yl)quinolin-4(1H)-one
| Internal ID | a88d2fea-9c15-455a-8188-c204b2d1ce17 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 2-[(E)-non-2-enyl]-1H-quinolin-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H23NO/c1-2-3-4-5-6-7-8-11-15-14-18(20)16-12-9-10-13-17(16)19-15/h7-10,12-14H,2-6,11H2,1H3,(H,19,20)/b8-7+ |
| InChI Key | OLHDQSVEEMQKAE-BQYQJAHWSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.177964357 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 5.50 |
| CHEMBL4797651 |
| (E)-2-(non-2-en-1-yl)quinolin-4(1H)-one |
| (e)-2-(non-2-en-1-yl) quinolin-4(1h)-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.84% | 98.95% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 97.70% | 92.08% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.79% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.88% | 95.56% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 95.00% | 97.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 94.75% | 91.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.08% | 99.17% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 93.89% | 91.81% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.19% | 93.99% |
| CHEMBL240 | Q12809 | HERG | 91.40% | 89.76% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.08% | 89.63% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.75% | 93.31% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.28% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.77% | 94.45% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.61% | 98.59% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.78% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.10% | 89.00% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 82.05% | 85.00% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.14% | 92.97% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.31% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 70272795 |
| LOTUS | LTS0183205 |
| wikiData | Q105193981 |