(E)-2-(hept-1-enyl)-3-(hydroxymethyl)-5-(3-methylbut-2-enyl)benzene-1,4-diol
| Internal ID | 7d3f4977-d162-43ef-aedf-449d0667690d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Quinone and hydroquinone lipids > Prenylated hydroquinones |
| IUPAC Name | 2-[(E)-hept-1-enyl]-3-(hydroxymethyl)-5-(3-methylbut-2-enyl)benzene-1,4-diol |
| SMILES (Canonical) | CCCCCC=CC1=C(C=C(C(=C1CO)O)CC=C(C)C)O |
| SMILES (Isomeric) | CCCCC/C=C/C1=C(C=C(C(=C1CO)O)CC=C(C)C)O |
| InChI | InChI=1S/C19H28O3/c1-4-5-6-7-8-9-16-17(13-20)19(22)15(12-18(16)21)11-10-14(2)3/h8-10,12,20-22H,4-7,11,13H2,1-3H3/b9-8+ |
| InChI Key | DLFLMSMGNSXYFJ-CMDGGOBGSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20384475 g/mol |
| Topological Polar Surface Area (TPSA) | 60.70 Ų |
| XlogP | 5.90 |
| RefChem:69998 |
| 2-HHMBD |
| 2-((E)-hept-1-enyl)-3-(hydroxymethyl)-5-(3-methylbut-2-enyl)benzene-1,4-diol |
| CHEMBL1813662 |
| CHEBI:68186 |
| BDBM50350090 |
| Q27136680 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.63% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.73% | 98.95% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.28% | 92.08% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.73% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.50% | 94.73% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.10% | 89.63% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.40% | 96.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.75% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.96% | 86.33% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 88.59% | 98.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.46% | 91.49% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.94% | 97.21% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.69% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.95% | 94.45% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.45% | 96.90% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.42% | 91.71% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 81.88% | 99.43% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.98% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.70% | 92.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.35% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 53388784 |
| LOTUS | LTS0080663 |
| wikiData | Q27136680 |