Dunnianol
Internal ID | 138253cc-8c19-4a80-8f6f-5f2ad9f1cd8a |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Terphenyls > M-terphenyls |
IUPAC Name | 2,6-bis(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
SMILES (Canonical) | C=CCC1=CC(=C(C=C1)O)C2=CC(=CC(=C2O)C3=C(C=CC(=C3)CC=C)O)CC=C |
SMILES (Isomeric) | C=CCC1=CC(=C(C=C1)O)C2=CC(=CC(=C2O)C3=C(C=CC(=C3)CC=C)O)CC=C |
InChI | InChI=1S/C27H26O3/c1-4-7-18-10-12-25(28)21(14-18)23-16-20(9-6-3)17-24(27(23)30)22-15-19(8-5-2)11-13-26(22)29/h4-6,10-17,28-30H,1-3,7-9H2 |
InChI Key | PLBCEMUNKQWXGZ-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C27H26O3 |
Molecular Weight | 398.50 g/mol |
Exact Mass | 398.18819469 g/mol |
Topological Polar Surface Area (TPSA) | 60.70 Ų |
XlogP | 7.30 |
139726-29-7 |
Dunnial |
2,6-bis(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
HY-N3789 |
AKOS032948727 |
FS-10333 |
CS-0024217 |
A885954 |
B0005-189704 |
5,5',5''-Triallyl-1,1':3',1''-terphenyl-2,2',2''-triol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.45% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.47% | 91.11% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 92.71% | 90.24% |
CHEMBL2581 | P07339 | Cathepsin D | 92.13% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 85.79% | 90.71% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.00% | 98.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.73% | 90.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.46% | 95.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.20% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.19% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.49% | 95.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.44% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.29% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.06% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Illicium dunnianum |
Illicium simonsii |
PubChem | 15714605 |
LOTUS | LTS0137949 |
wikiData | Q104402682 |