Dulcinol
Internal ID | 5c7fad6e-8f43-4465-ab49-1715a8a1f059 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | [(1S,2S,6R,7R,8R,10S,13S)-6-(hydroxymethyl)-2,6,13-trimethyl-12-oxo-8-tetracyclo[11.2.1.01,10.02,7]hexadecanyl] benzoate |
SMILES (Canonical) | CC12CCC3(C1)C(CC(C4C3(CCCC4(C)CO)C)OC(=O)C5=CC=CC=C5)CC2=O |
SMILES (Isomeric) | C[C@]12CC[C@]3(C1)[C@@H](C[C@H]([C@@H]4[C@@]3(CCC[C@@]4(C)CO)C)OC(=O)C5=CC=CC=C5)CC2=O |
InChI | InChI=1S/C27H36O4/c1-24-12-13-27(16-24)19(15-21(24)29)14-20(31-23(30)18-8-5-4-6-9-18)22-25(2,17-28)10-7-11-26(22,27)3/h4-6,8-9,19-20,22,28H,7,10-17H2,1-3H3/t19-,20+,22-,24-,25-,26-,27-/m0/s1 |
InChI Key | CFPMRJFTBKYCRR-FOOPCEIZSA-N |
Popularity | 8 references in papers |
Molecular Formula | C27H36O4 |
Molecular Weight | 424.60 g/mol |
Exact Mass | 424.26135963 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 5.30 |
[(1S,2S,6R,7R,8R,10S,13S)-6-(hydroxymethyl)-2,6,13-trimethyl-12-oxo-8-tetracyclo[11.2.1.01,10.02,7]hexadecanyl] benzoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.02% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.32% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.67% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.60% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.91% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.88% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.74% | 96.95% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 88.72% | 92.67% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.86% | 97.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.37% | 94.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.97% | 95.50% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 85.28% | 94.23% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.72% | 82.69% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.51% | 99.23% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.40% | 97.79% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.60% | 91.19% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.74% | 97.25% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.27% | 95.83% |
CHEMBL5028 | O14672 | ADAM10 | 81.00% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scoparia dulcis |
PubChem | 10993579 |
LOTUS | LTS0083897 |
wikiData | Q104956856 |