Duguetine
| Internal ID | 9e2b5c44-2c08-4484-be41-c5c522168d00 |
| Taxonomy | Alkaloids and derivatives > Aporphines > Hydroxy-7-aporphines |
| IUPAC Name | (12S,13S)-16,17-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaen-13-ol |
| SMILES (Canonical) | CN1CCC2=CC3=C(C4=C2C1C(C5=CC(=C(C=C54)OC)OC)O)OCO3 |
| SMILES (Isomeric) | CN1CCC2=CC3=C(C4=C2[C@H]1[C@H](C5=CC(=C(C=C54)OC)OC)O)OCO3 |
| InChI | InChI=1S/C20H21NO5/c1-21-5-4-10-6-15-20(26-9-25-15)17-11-7-13(23-2)14(24-3)8-12(11)19(22)18(21)16(10)17/h6-8,18-19,22H,4-5,9H2,1-3H3/t18-,19-/m0/s1 |
| InChI Key | ZAVWGRCRKSHIMO-OALUTQOASA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14197277 g/mol |
| Topological Polar Surface Area (TPSA) | 60.40 Ų |
| XlogP | 2.10 |
| (12S,13S)-16,17-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo(10.7.1.02,6.08,20.014,19)icosa-1(20),2(6),7,14,16,18-hexaen-13-ol |
| (12S,13S)-16,17-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaen-13-ol |
| RefChem:135960 |
| 31984-61-9 |
| CHEMBL4444630 |
| SCHEMBL14838824 |
| CHEBI:181139 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.09% | 96.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.42% | 96.77% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 94.25% | 82.67% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.90% | 92.62% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.84% | 93.40% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 91.15% | 96.86% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.85% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.56% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.29% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.41% | 90.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.73% | 92.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.31% | 95.56% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 88.03% | 91.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.17% | 86.33% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.04% | 89.50% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.07% | 95.78% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.59% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.85% | 89.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.77% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.64% | 91.11% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.98% | 97.31% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.75% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.59% | 94.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 82.43% | 95.12% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 82.24% | 96.76% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.08% | 91.79% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.83% | 90.95% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.04% | 91.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.73% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Duguetia flagellaris |
| Duguetia furfuracea |
| PubChem | 45102748 |
| LOTUS | LTS0182911 |
| wikiData | Q104400177 |