Drechslerine G
| Internal ID | 7e053a4d-edb3-4f34-b07d-94faaea3720e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1S,5R,8R)-8-(hydroxymethyl)-2-methyl-5-propan-2-yl-9-oxatricyclo[4.4.0.02,8]decane-7-carbaldehyde |
| SMILES (Canonical) | CC(C)C1CCC2(C3C1C(C2(OC3)CO)C=O)C |
| SMILES (Isomeric) | CC(C)[C@H]1CCC2([C@@H]3C1C([C@]2(OC3)CO)C=O)C |
| InChI | InChI=1S/C15H24O3/c1-9(2)10-4-5-14(3)12-7-18-15(14,8-17)11(6-16)13(10)12/h6,9-13,17H,4-5,7-8H2,1-3H3/t10-,11?,12+,13?,14?,15-/m1/s1 |
| InChI Key | WSAMOBBNJHGXEQ-IHRAKWIESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17254462 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.67% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.39% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.49% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.46% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.16% | 100.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.83% | 94.80% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.64% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.64% | 96.77% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.57% | 96.61% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.95% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.36% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.31% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.54% | 92.62% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.23% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.02% | 97.09% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.33% | 92.88% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.58% | 96.43% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.35% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21776420 |
| LOTUS | LTS0069390 |
| wikiData | Q77375854 |