Domesticoside
Internal ID | 0b09ab23-f0e4-4334-ab1d-ecc75b26e397 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 1-[2-hydroxy-4-methoxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone |
SMILES (Canonical) | CC(=O)C1=C(C=C(C=C1OC2C(C(C(C(O2)CO)O)O)O)OC)O |
SMILES (Isomeric) | CC(=O)C1=C(C=C(C=C1OC2C(C(C(C(O2)CO)O)O)O)OC)O |
InChI | InChI=1S/C15H20O9/c1-6(17)11-8(18)3-7(22-2)4-9(11)23-15-14(21)13(20)12(19)10(5-16)24-15/h3-4,10,12-16,18-21H,5H2,1-2H3 |
InChI Key | XERRGONJPVYTDB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H20O9 |
Molecular Weight | 344.31 g/mol |
Exact Mass | 344.11073221 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | -0.60 |
pleoside |
CHEBI:168004 |
1-[2-hydroxy-4-methoxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.67% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.88% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.50% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.74% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.06% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.09% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.40% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.24% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.84% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.21% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.08% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.84% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.39% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.06% | 95.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.53% | 92.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.38% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.31% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ferula hyrcana |
Lepisorus thunbergianus |
PubChem | 75072039 |
LOTUS | LTS0083539 |
wikiData | Q105326561 |