Dodecanamide
| Internal ID | 43298d7e-258a-4a18-b111-0cb504f1c243 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides |
| IUPAC Name | dodecanamide |
| SMILES (Canonical) | CCCCCCCCCCCC(=O)N |
| SMILES (Isomeric) | CCCCCCCCCCCC(=O)N |
| InChI | InChI=1S/C12H25NO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H2,13,14) |
| InChI Key | ILRSCQWREDREME-UHFFFAOYSA-N |
| Popularity | 197 references in papers |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.33 g/mol |
| Exact Mass | 199.193614421 g/mol |
| Topological Polar Surface Area (TPSA) | 43.10 Ų |
| XlogP | 3.50 |
| Lauramide |
| 1120-16-7 |
| Dodecylamide |
| Lauric amide |
| Lauryl amide |
| Dodecamide |
| Amide KK |
| Lauric acid amide |
| Dodecanoic acid amide |
| NSC 889 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.87% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.40% | 99.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.84% | 97.29% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.01% | 92.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.55% | 98.95% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.92% | 96.95% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.62% | 91.81% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.94% | 89.63% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.25% | 92.86% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.53% | 83.82% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.42% | 100.00% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 81.11% | 85.94% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.03% | 97.25% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.99% | 87.45% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.84% | 95.17% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.67% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vitis vinifera |
| PubChem | 14256 |
| LOTUS | LTS0115522 |
| wikiData | Q27116246 |