Dodecahydro-7a,11b-diaza-benzo[de]anthracene
| Internal ID | 9364d2aa-0c05-45db-917c-3f9c93b0a528 |
| Taxonomy | Organoheterocyclic compounds > Pyridopyrimidines |
| IUPAC Name | 1,7-diazatetracyclo[7.7.1.02,7.013,17]heptadecane |
| SMILES (Canonical) | C1CCN2CC3CCCC4C3N(C2C1)CCC4 |
| SMILES (Isomeric) | C1CCN2CC3CCCC4C3N(C2C1)CCC4 |
| InChI | InChI=1S/C15H26N2/c1-2-9-16-11-13-6-3-5-12-7-4-10-17(15(12)13)14(16)8-1/h12-15H,1-11H2 |
| InChI Key | ZUZDBCDZKDLXPJ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.209598838 g/mol |
| Topological Polar Surface Area (TPSA) | 6.50 Ų |
| XlogP | 3.20 |
| ZUZDBCDZKDLXPJ-UHFFFAOYSA-N |
| perhydro-1,10-propano-4a,8a-diazaphenanthrene |
![2D Structure of Dodecahydro-7a,11b-diaza-benzo[de]anthracene](https://plantaedb.com/storage/docs/compounds/2023/11/dodecahydro-7a11b-diaza-benzodeanthracene.jpg "2D Structure of Dodecahydro-7a,11b-diaza-benzo[de]anthracene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 91.66% | 91.76% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.16% | 97.25% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 90.77% | 94.78% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 88.37% | 95.61% |
| CHEMBL240 | Q12809 | HERG | 88.26% | 89.76% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 88.22% | 92.38% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 87.85% | 96.03% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 87.75% | 98.10% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 86.81% | 99.18% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.30% | 97.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 86.26% | 98.33% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.06% | 93.04% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.49% | 95.50% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 84.91% | 95.34% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 83.84% | 98.99% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.68% | 90.24% |
| CHEMBL2094108 | P49354 | Protein farnesyltransferase | 82.34% | 97.92% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.20% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.17% | 95.89% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 82.11% | 96.67% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 82.08% | 98.77% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 81.82% | 97.98% |
| CHEMBL267 | P12931 | Tyrosine-protein kinase SRC | 81.46% | 95.69% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 80.84% | 99.29% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.74% | 98.46% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.60% | 98.95% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.20% | 93.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.12% | 92.94% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 80.05% | 91.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nitraria billardierei |
| Nitraria schoberi |
| Nitraria sibirica |
| PubChem | 4238630 |
| LOTUS | LTS0084724 |
| wikiData | Q104403007 |