Docos-6-enamide
| Internal ID | c3154cc3-ae97-40a9-86c9-cf184ff08aff |
| Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids |
| IUPAC Name | docos-6-enamide |
| SMILES (Canonical) | CCCCCCCCCCCCCCCC=CCCCCC(=O)N |
| SMILES (Isomeric) | CCCCCCCCCCCCCCCC=CCCCCC(=O)N |
| InChI | InChI=1S/C22H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h16-17H,2-15,18-21H2,1H3,(H2,23,24) |
| InChI Key | COUPDYRANTUKKV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H43NO |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 337.334464995 g/mol |
| Topological Polar Surface Area (TPSA) | 43.10 Ų |
| XlogP | 8.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.25% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.31% | 96.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.15% | 92.08% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.29% | 89.63% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.46% | 96.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.42% | 97.29% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.60% | 98.95% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.75% | 91.81% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.23% | 92.86% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.94% | 89.34% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 85.83% | 97.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.58% | 91.11% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.11% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.33% | 90.17% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 81.11% | 85.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asimina parviflora |
| Rubia yunnanensis |
| PubChem | 53732411 |
| LOTUS | LTS0125254 |
| wikiData | Q104967308 |