DL-Alaninol
| Internal ID | 5b8f9ef3-99d7-4d49-b8e9-d476aec6150e |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Amines > Alkanolamines > 1,2-aminoalcohols |
| IUPAC Name | 2-aminopropan-1-ol |
| SMILES (Canonical) | CC(CO)N |
| SMILES (Isomeric) | CC(CO)N |
| InChI | InChI=1S/C3H9NO/c1-3(4)2-5/h3,5H,2,4H2,1H3 |
| InChI Key | BKMMTJMQCTUHRP-UHFFFAOYSA-N |
| Popularity | 145 references in papers |
| Molecular Formula | C3H9NO |
| Molecular Weight | 75.11 g/mol |
| Exact Mass | 75.068413911 g/mol |
| Topological Polar Surface Area (TPSA) | 46.20 Ų |
| XlogP | -1.00 |
| 6168-72-5 |
| 2-Aminopropan-1-ol |
| 2-Amino-1-propanol |
| 2-Aminopropanol |
| DL-2-Amino-1-propanol |
| 1-Propanol, 2-amino- |
| 1-Hydroxy-2-aminopropane |
| Propanol, 2-amino- |
| 1-Methyl-2-hydroxyethylamine |
| 78-91-1 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.92% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.94% | 96.09% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 90.65% | 87.45% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.70% | 97.29% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.46% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nelumbo nucifera |