Maleic acid, disodium salt
| Internal ID | be9757fc-4bc7-4339-b4e1-0a9d10fd5e22 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Dicarboxylic acids and derivatives |
| IUPAC Name | disodium;(Z)-but-2-enedioate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C4H4O4.2Na/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/q;2*+1/p-2/b2-1-;; |
| InChI Key | MSJMDZAOKORVFC-UAIGNFCESA-L |
| Popularity | 1,188 references in papers |
| Molecular Formula | C4H2Na2O4 |
| Molecular Weight | 160.04 g/mol |
| Exact Mass | 159.97484710 g/mol |
| Topological Polar Surface Area (TPSA) | 80.30 Ų |
| XlogP | 0.00 |
| RefChem:887667 |
| Disodium maleate |
| Sodium maleate |
| Maleic acid disodium salt |
| 371-47-1 |
| disodium;(Z)-but-2-enedioate |
| 2-Butenedioic acid (Z)-, disodium salt |
| Maleic acid,disodium salt |
| MFCD00013059 |
| disodium (2Z)-but-2-enedioate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| No predicted targets yet! | ||||
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 6364608 |
| NPASS | NPC323552 |
| ChEMBL | CHEMBL449139 |