Diprotin B
| Internal ID | 03dac308-7936-4755-95b2-b9ca120d656b |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (2S)-2-[[(2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)O)NC(=O)C1CCCN1C(=O)C(C(C)C)N |
| SMILES (Isomeric) | CC(C)C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C(C)C)N |
| InChI | InChI=1S/C16H29N3O4/c1-9(2)8-11(16(22)23)18-14(20)12-6-5-7-19(12)15(21)13(17)10(3)4/h9-13H,5-8,17H2,1-4H3,(H,18,20)(H,22,23)/t11-,12-,13-/m0/s1 |
| InChI Key | NHXZRXLFOBFMDM-AVGNSLFASA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.21580641 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | -2.60 |
| Atomic LogP (AlogP) | 0.58 |
| H-Bond Acceptor | 4 |
| H-Bond Donor | 3 |
| Rotatable Bonds | 7 |
| 90614-49-6 |
| H-Val-Pro-Leu-OH |
| valyl-prolyl-leucine |
| VAL-PRO-LEU |
| L-valyl-L-prolyl-L-leucine |
| (2S)-2-[[(2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |
| N-(1-L-Valyl-L-prolyl)-L-leucine |
| BRN 4268092 |
| (S)-2-((S)-1-((S)-2-Amino-3-methylbutanoyl)pyrrolidine-2-carboxamido)-4-methylpentanoic acid |
| Val-Pro-Leu-OH |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5507 | 55.07% |
| Caco-2 | - | 0.6039 | 60.39% |
| Blood Brain Barrier | - | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.5143 | 51.43% |
| Subcellular localzation | Mitochondria | 0.5069 | 50.69% |
| OATP2B1 inhibitior | - | 0.8542 | 85.42% |
| OATP1B1 inhibitior | + | 0.9413 | 94.13% |
| OATP1B3 inhibitior | + | 0.9480 | 94.80% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | - | 0.9404 | 94.04% |
| P-glycoprotein inhibitior | - | 0.8757 | 87.57% |
| P-glycoprotein substrate | - | 0.5233 | 52.33% |
| CYP3A4 substrate | + | 0.5353 | 53.53% |
| CYP2C9 substrate | - | 0.8005 | 80.05% |
| CYP2D6 substrate | - | 0.8236 | 82.36% |
| CYP3A4 inhibition | - | 0.9033 | 90.33% |
| CYP2C9 inhibition | - | 0.9507 | 95.07% |
| CYP2C19 inhibition | - | 0.8682 | 86.82% |
| CYP2D6 inhibition | - | 0.9584 | 95.84% |
| CYP1A2 inhibition | - | 0.8802 | 88.02% |
| CYP2C8 inhibition | - | 0.9657 | 96.57% |
| CYP inhibitory promiscuity | - | 0.9874 | 98.74% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8900 | 89.00% |
| Carcinogenicity (trinary) | Non-required | 0.6652 | 66.52% |
| Eye corrosion | - | 0.9852 | 98.52% |
| Eye irritation | - | 0.9922 | 99.22% |
| Skin irritation | - | 0.7839 | 78.39% |
| Skin corrosion | - | 0.9141 | 91.41% |
| Ames mutagenesis | - | 0.7000 | 70.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.7505 | 75.05% |
| Micronuclear | + | 0.6300 | 63.00% |
| Hepatotoxicity | + | 0.7500 | 75.00% |
| skin sensitisation | - | 0.9141 | 91.41% |
| Respiratory toxicity | + | 0.7556 | 75.56% |
| Reproductive toxicity | + | 0.8667 | 86.67% |
| Mitochondrial toxicity | + | 0.6625 | 66.25% |
| Nephrotoxicity | - | 0.7560 | 75.60% |
| Acute Oral Toxicity (c) | III | 0.6602 | 66.02% |
| Estrogen receptor binding | - | 0.5421 | 54.21% |
| Androgen receptor binding | - | 0.5573 | 55.73% |
| Thyroid receptor binding | + | 0.6188 | 61.88% |
| Glucocorticoid receptor binding | - | 0.4874 | 48.74% |
| Aromatase binding | - | 0.6992 | 69.92% |
| PPAR gamma | - | 0.5000 | 50.00% |
| Honey bee toxicity | - | 0.9525 | 95.25% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.7100 | 71.00% |
| Fish aquatic toxicity | + | 0.7045 | 70.45% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL237 | P41145 | Kappa opioid receptor | 98.66% | 98.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.12% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.16% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.74% | 90.17% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.69% | 98.33% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.47% | 89.63% |
| CHEMBL204 | P00734 | Thrombin | 95.41% | 96.01% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.30% | 93.56% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 95.27% | 98.24% |
| CHEMBL3837 | P07711 | Cathepsin L | 94.12% | 96.61% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 93.87% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.52% | 96.47% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.52% | 83.82% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 91.70% | 97.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.98% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 90.91% | 93.10% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 90.46% | 98.77% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 89.62% | 96.03% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.57% | 97.25% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 89.45% | 92.80% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.78% | 91.19% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.10% | 90.71% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.35% | 100.00% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 86.16% | 96.67% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.03% | 94.33% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 85.63% | 92.38% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 84.59% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.49% | 97.09% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.79% | 90.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.47% | 90.00% |
| CHEMBL268 | P43235 | Cathepsin K | 82.83% | 96.85% |
| CHEMBL5028 | O14672 | ADAM10 | 82.69% | 97.50% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 81.27% | 97.43% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 81.04% | 94.50% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 80.73% | 93.33% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.67% | 99.18% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 80.65% | 95.36% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 80.36% | 97.86% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.31% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146208 |
| LOTUS | LTS0016524 |
| wikiData | Q82892954 |