Diphenyleneiodonium
| Internal ID | 38e1dfdb-b3cf-49fd-ada7-8c22f13f08d6 |
| Taxonomy | Organohalogen compounds > Aryl halides > Aryl iodides |
| IUPAC Name | 8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES (Canonical) | C1=CC=C2C(=C1)C3=CC=CC=C3[I+]2 |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C3=CC=CC=C3[I+]2 |
| InChI | InChI=1S/C12H8I/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H/q+1 |
| InChI Key | QFXKXRXFBRLLPQ-UHFFFAOYSA-N |
| Popularity | 953 references in papers |
| Molecular Formula | C12H8I+ |
| Molecular Weight | 279.10 g/mol |
| Exact Mass | 278.96707 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.10 |
| Atomic LogP (AlogP) | -0.20 |
| H-Bond Acceptor | 0 |
| H-Bond Donor | 0 |
| Rotatable Bonds | 0 |
| Dibenziodolium |
| 244-54-2 |
| 2,2'-Biphenylyleneiodonium |
| Diphenylene iodonium |
| (1,1'-Biphenyl)-2,2'-diyliodonium |
| CHEBI:77986 |
| 6HJ411TU98 |
| 8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| 8-iodoniatricyclo(7.4.0.02,7)trideca-1(13),2,4,6,9,11-hexaene |
| RefChem:920408 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9801 | 98.01% |
| Caco-2 | + | 0.8657 | 86.57% |
| Blood Brain Barrier | + | 0.9750 | 97.50% |
| Human oral bioavailability | + | 0.8429 | 84.29% |
| Subcellular localzation | Lysosomes | 0.5055 | 50.55% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9545 | 95.45% |
| OATP1B3 inhibitior | + | 0.9542 | 95.42% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | - | 0.7191 | 71.91% |
| P-glycoprotein inhibitior | - | 0.9603 | 96.03% |
| P-glycoprotein substrate | - | 0.9752 | 97.52% |
| CYP3A4 substrate | - | 0.7325 | 73.25% |
| CYP2C9 substrate | - | 0.8005 | 80.05% |
| CYP2D6 substrate | - | 0.7555 | 75.55% |
| CYP3A4 inhibition | + | 0.7669 | 76.69% |
| CYP2C9 inhibition | + | 0.8949 | 89.49% |
| CYP2C19 inhibition | + | 0.8993 | 89.93% |
| CYP2D6 inhibition | + | 0.8879 | 88.79% |
| CYP1A2 inhibition | + | 0.9107 | 91.07% |
| CYP2C8 inhibition | - | 0.9194 | 91.94% |
| CYP inhibitory promiscuity | + | 0.7406 | 74.06% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.6150 | 61.50% |
| Carcinogenicity (trinary) | Non-required | 0.4099 | 40.99% |
| Eye corrosion | - | 0.7111 | 71.11% |
| Eye irritation | + | 1.0000 | 100.00% |
| Skin irritation | + | 0.6847 | 68.47% |
| Skin corrosion | - | 0.8123 | 81.23% |
| Ames mutagenesis | - | 0.7200 | 72.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.7242 | 72.42% |
| Micronuclear | + | 0.5379 | 53.79% |
| Hepatotoxicity | + | 0.7625 | 76.25% |
| skin sensitisation | + | 0.6772 | 67.72% |
| Respiratory toxicity | - | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.5889 | 58.89% |
| Mitochondrial toxicity | - | 0.8375 | 83.75% |
| Nephrotoxicity | + | 0.6752 | 67.52% |
| Acute Oral Toxicity (c) | III | 0.5745 | 57.45% |
| Estrogen receptor binding | + | 0.6844 | 68.44% |
| Androgen receptor binding | - | 0.6299 | 62.99% |
| Thyroid receptor binding | + | 0.5502 | 55.02% |
| Glucocorticoid receptor binding | - | 0.5000 | 50.00% |
| Aromatase binding | + | 0.5733 | 57.33% |
| PPAR gamma | + | 0.6985 | 69.85% |
| Honey bee toxicity | - | 0.9098 | 90.98% |
| Biodegradation | - | 0.9250 | 92.50% |
| Crustacea aquatic toxicity | + | 0.8800 | 88.00% |
| Fish aquatic toxicity | + | 0.9862 | 98.62% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM 31622.8 nM |
Potency Potency |
via CMAUP
PMID: 18718694 |
| CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
12589.3 nM 12589.3 nM |
Potency Potency |
PMID: 19931461
PMID: 25238443 |
| CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
125.89 nM 19.95 nM |
AC50 AC50 |
PMID: 18284207
PMID: 15043446 |
| CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
63.1 nM 501.2 nM |
Potency Potency |
PMID: 19721074
PMID: 20421396 |
| CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
1000 nM 100 nM |
Potency Potency |
DOI: 10.1007/s00044-010-9338-x
PMID: 22916954 |
| CHEMBL289 | P10635 | Cytochrome P450 2D6 |
3981.1 nM 794.3 nM |
Potency Potency |
PMID: 18998696
PMID: 22019045 |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 |
3162.3 nM 3162.3 nM 3162.3 nM 3162.3 nM |
Potency Potency Potency Potency |
PMID: 16441084
via CMAUP PMID: 19921834 PMID: 8496706 |
| CHEMBL4040 | P28482 | MAP kinase ERK2 |
19952.6 nM |
Potency |
PMID: 18467007
|
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR |
46.5 nM 58.5 nM 46.5 nM 3288.5 nM |
Potency Potency Potency Potency |
PMID: 22545792
PMID: 26896705 via Super-PRED PMID: 17194827 |
| CHEMBL5401 | P42226 | Signal transducer and activator of transcription 6 |
15848.9 nM 15848.9 nM |
Potency Potency |
PMID: 24273638
PMID: 25036789 |
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
35.5 nM 35.5 nM |
Potency Potency |
via CMAUP
via Super-PRED |
| CHEMBL1293256 | P40225 | Thrombopoietin |
39.8 nM 39.8 nM 39.8 nM |
Potency Potency Potency |
via Super-PRED
PMID: 15646539 PMID: 15332845 |
| CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
20 nM 19952.6 nM 19952.6 nM |
Potency Potency Potency |
via Super-PRED
DOI: 10.6019/CHEMBL1201861 PMID: 14552774 |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.35% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.82% | 98.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.82% | 82.69% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.89% | 91.11% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.05% | 93.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ixora coccinea |
| PubChem | 3101 |
| NPASS | NPC473206 |
| ChEMBL | CHEMBL365739 |
| LOTUS | LTS0254377 |
| wikiData | Q27147567 |