Diphenylacetic acid
| Internal ID | 09b0a92b-b4e8-4c11-a5bc-02b598f1f9ca |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylmethanes |
| IUPAC Name | 2,2-diphenylacetic acid |
| SMILES (Canonical) | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)O |
| SMILES (Isomeric) | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)O |
| InChI | InChI=1S/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| InChI Key | PYHXGXCGESYPCW-UHFFFAOYSA-N |
| Popularity | 235 references in papers |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.083729621 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 3.10 |
| 2,2-diphenylacetic acid |
| 117-34-0 |
| Diphenylethanoic acid |
| Acetic acid, diphenyl- |
| Benzeneacetic acid, .alpha.-phenyl- |
| Benzeneacetic acid, alpha-phenyl- |
| MFCD00004251 |
| alpha-phenylbenzeneacetic acid |
| diphenyl acetic acid |
| Diphenyl-acetic acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.61% | 90.17% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.55% | 94.62% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 90.13% | 94.08% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.58% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.48% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.29% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.09% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.91% | 83.82% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.92% | 93.56% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.67% | 93.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stocksia brahuica |
| PubChem | 8333 |
| LOTUS | LTS0197560 |
| wikiData | Q22977245 |