Diphenyl sulfone
| Internal ID | acf3657a-cf36-4edf-bf26-c298b009bc25 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzenesulfonyl compounds |
| IUPAC Name | benzenesulfonylbenzene |
| SMILES (Canonical) | C1=CC=C(C=C1)S(=O)(=O)C2=CC=CC=C2 |
| SMILES (Isomeric) | C1=CC=C(C=C1)S(=O)(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C12H10O2S/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChI Key | KZTYYGOKRVBIMI-UHFFFAOYSA-N |
| Popularity | 645 references in papers |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.04015073 g/mol |
| Topological Polar Surface Area (TPSA) | 42.50 Ų |
| XlogP | 2.40 |
| 127-63-9 |
| Phenyl sulfone |
| DIPHENYLSULFONE |
| Sulfobenzide |
| Benzene, 1,1'-sulfonylbis- |
| Diphenyl sulphone |
| Phenyl sulphone |
| benzenesulfonylbenzene |
| 1,1'-sulfonyldibenzene |
| Sulfone, diphenyl |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.66% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.68% | 98.95% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.01% | 94.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.48% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.10% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Myriactis humilis |
| PubChem | 31386 |
| LOTUS | LTS0073375 |
| wikiData | Q5279737 |