Diosbulbinoside D
Internal ID | 8c6c42de-b875-4181-a902-aa2b607c52af |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | (1R,5S,8S,10S,11S,13R)-8-(furan-3-yl)-10-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7,14-dioxatetracyclo[11.2.1.02,11.05,10]hexadec-2-ene-6,15-dione |
SMILES (Canonical) | CC12CC(OC(=O)C1CC(=C3C2CC4CC3C(=O)O4)OC5C(C(C(C(O5)CO)O)O)O)C6=COC=C6 |
SMILES (Isomeric) | C[C@@]12C[C@H](OC(=O)[C@H]1CC(=C3[C@H]2C[C@@H]4C[C@H]3C(=O)O4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C6=COC=C6 |
InChI | InChI=1S/C25H30O11/c1-25-7-16(10-2-3-32-9-10)34-23(31)14(25)6-15(18-12-4-11(5-13(18)25)33-22(12)30)35-24-21(29)20(28)19(27)17(8-26)36-24/h2-3,9,11-14,16-17,19-21,24,26-29H,4-8H2,1H3/t11-,12+,13+,14+,16-,17+,19+,20-,21+,24+,25-/m0/s1 |
InChI Key | KXNADXBKEHOTDP-DRXALLTBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H30O11 |
Molecular Weight | 506.50 g/mol |
Exact Mass | 506.17881177 g/mol |
Topological Polar Surface Area (TPSA) | 165.00 Ų |
XlogP | -0.30 |
66756-59-0 |
DTXSID10985334 |
CHEBI:178149 |
(1R,5S,8S,10S,11S,13R)-8-(uran-3-yl)-10-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7,14-dioxatetracyclo[11.2.1.02,11.05,10]hexadec-2-ene-6,15-dione |
2-(Furan-3-yl)-11b-methyl-4,8-dioxo-1,4,4a,5,7,8,10,11,11a,11b-decahydro-2H-7,10-methanopyrano[4,3-g][3]benzoxepin-6-yl hexopyranoside |
![2D Structure of Diosbulbinoside D 2D Structure of Diosbulbinoside D](https://plantaedb.com/storage/docs/compounds/2023/11/diosbulbinoside-d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.90% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.86% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.61% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.54% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.29% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.69% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.23% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.15% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.33% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.60% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.94% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.44% | 96.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.01% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea bulbifera |
PubChem | 181843 |
LOTUS | LTS0092618 |
wikiData | Q82972845 |