Diosbulbin-D
Internal ID | 66403eb6-9cfa-4b64-8b65-bac309b616cf |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | (1R,2S,5S,8S,10S,11R,13R)-8-(furan-3-yl)-10-methyl-7,14-dioxatetracyclo[11.2.1.02,11.05,10]hexadecane-3,6,15-trione |
SMILES (Canonical) | CC12CC(OC(=O)C1CC(=O)C3C2CC4CC3C(=O)O4)C5=COC=C5 |
SMILES (Isomeric) | C[C@@]12C[C@H](OC(=O)[C@H]1CC(=O)[C@H]3[C@H]2C[C@@H]4C[C@H]3C(=O)O4)C5=COC=C5 |
InChI | InChI=1S/C19H20O6/c1-19-7-15(9-2-3-23-8-9)25-18(22)13(19)6-14(20)16-11-4-10(5-12(16)19)24-17(11)21/h2-3,8,10-13,15-16H,4-7H2,1H3/t10-,11+,12+,13+,15-,16+,19-/m0/s1 |
InChI Key | FJCWYLRNGKSUCH-OXIVVSFQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H20O6 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 82.80 Ų |
XlogP | 1.40 |
FS-8939 |
15,16-Epoxy-19-nor-6-oxo-13(16),14-clerodadiene-17,12:18,2-diolide |
![2D Structure of Diosbulbin-D 2D Structure of Diosbulbin-D](https://plantaedb.com/storage/docs/compounds/2023/11/diosbulbin-d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.63% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.38% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.42% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.96% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.02% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.44% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.09% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.42% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.06% | 94.73% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.79% | 90.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.36% | 89.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.97% | 93.40% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.39% | 100.00% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.17% | 85.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.11% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.87% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea bulbifera |
PubChem | 21723241 |
LOTUS | LTS0138022 |
wikiData | Q104995987 |