Dioncophylline E
Internal ID | 6ea3f8b2-b3bd-40c9-90b5-6b888ea5b7d4 |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Naphthylisoquinolines |
IUPAC Name | (1R,3R)-7-(1-hydroxy-8-methoxy-3-methylnaphthalen-2-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
SMILES (Canonical) | CC1CC2=C(C(N1)C)C(=C(C=C2)C3=C(C4=C(C=CC=C4OC)C=C3C)O)O |
SMILES (Isomeric) | C[C@@H]1CC2=C([C@H](N1)C)C(=C(C=C2)C3=C(C4=C(C=CC=C4OC)C=C3C)O)O |
InChI | InChI=1S/C23H25NO3/c1-12-10-15-6-5-7-18(27-4)21(15)23(26)19(12)17-9-8-16-11-13(2)24-14(3)20(16)22(17)25/h5-10,13-14,24-26H,11H2,1-4H3/t13-,14-/m1/s1 |
InChI Key | BLXBQYFTXJFAFN-ZIAGYGMSSA-N |
Popularity | 2 references in papers |
Molecular Formula | C23H25NO3 |
Molecular Weight | 363.40 g/mol |
Exact Mass | 363.18344366 g/mol |
Topological Polar Surface Area (TPSA) | 61.70 Ų |
XlogP | 4.70 |
(1R,3R)-7-(1-hydroxy-8-methoxy-3-methylnaphthalen-2-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
7-(1-Hydroxy-8-methoxy-3-methyl-naphthalen-2-yl)-1,3-dimethyl-1,2,3,4-tetrahydro-isoquinolin-8-ol |
8-isoquinolinol, 1,2,3,4-tetrahydro-7-(1-hydroxy-8-methoxy-3-methyl-2-naphthalenyl)-1,3-dimethyl-, (1R,3R)- |
InChI=1/C23H25NO3/c1-12-10-15-6-5-7-18(27-4)21(15)23(26)19(12)17-9-8-16-11-13(2)24-14(3)20(16)22(17)25/h5-10,13-14,24-26H,11H2,1-4H3/t13-,14-/m1/s |
rel-(1R,3R)-7-(1-hydroxy-8-methoxy-3-methyl-2-naphthyl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.42% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.73% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.57% | 98.95% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 95.37% | 91.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.32% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.52% | 96.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.29% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.80% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 90.03% | 98.75% |
CHEMBL1907 | P15144 | Aminopeptidase N | 89.40% | 93.31% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.25% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.29% | 96.21% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.02% | 92.94% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.95% | 99.17% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 86.88% | 94.03% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.25% | 89.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.16% | 99.15% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.10% | 93.18% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 84.90% | 96.39% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.88% | 90.00% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.52% | 96.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.06% | 95.89% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.59% | 95.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.96% | 93.03% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.56% | 90.24% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.32% | 93.99% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 80.70% | 95.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioncophyllum thollonii |
PubChem | 636569 |
LOTUS | LTS0037157 |
wikiData | Q104938226 |