Dioncophyllin d
Internal ID | 90b6c408-a2ba-4be0-aecc-dcb62b3e8fee |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Naphthylisoquinolines |
IUPAC Name | 7-(4-hydroxy-5-methoxy-7-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
SMILES (Canonical) | CC1CC2=C(C(N1)C)C(=C(C=C2)C3=C4C=C(C=C(C4=C(C=C3)O)OC)C)O |
SMILES (Isomeric) | CC1CC2=C(C(N1)C)C(=C(C=C2)C3=C4C=C(C=C(C4=C(C=C3)O)OC)C)O |
InChI | InChI=1S/C23H25NO3/c1-12-9-18-16(7-8-19(25)22(18)20(10-12)27-4)17-6-5-15-11-13(2)24-14(3)21(15)23(17)26/h5-10,13-14,24-26H,11H2,1-4H3 |
InChI Key | ZTVGDICRDKHNSL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H25NO3 |
Molecular Weight | 363.40 g/mol |
Exact Mass | 363.18344366 g/mol |
Topological Polar Surface Area (TPSA) | 61.70 Ų |
XlogP | 4.70 |
ZTVGDICRDKHNSL-UHFFFAOYSA-N |
7-(4-Hydroxy-5-methoxy-7-methyl-1-naphthyl)-1,3-dimethyl-1,2,3,4-tetrahydro-8-isoquinolinol # |
![2D Structure of Dioncophyllin d 2D Structure of Dioncophyllin d](https://plantaedb.com/storage/docs/compounds/2023/11/dioncophyllin-d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.00% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.54% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.22% | 92.94% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 93.27% | 91.79% |
CHEMBL2581 | P07339 | Cathepsin D | 92.58% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.35% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.18% | 89.62% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.85% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.74% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.61% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.96% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.95% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.47% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.98% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.51% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.05% | 94.45% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.01% | 96.95% |
CHEMBL2535 | P11166 | Glucose transporter | 83.42% | 98.75% |
CHEMBL5903 | Q04771 | Activin receptor type-1 | 82.65% | 89.93% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.39% | 90.24% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.10% | 93.31% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.96% | 96.21% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 80.95% | 97.31% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 80.66% | 88.48% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.40% | 93.18% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.11% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Triphyophyllum peltatum |
PubChem | 631577 |
LOTUS | LTS0274744 |
wikiData | Q105383247 |