Dioncophyllacine A
| Internal ID | f3b0f560-d3f7-415e-85b4-7e6468d6f4c0 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Naphthylisoquinolines |
| IUPAC Name | 7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-4,8-dimethoxy-1,3-dimethylisoquinoline |
| SMILES (Canonical) | CC1=CC(=C2C(=C1C3=C(C4=C(N=C(C(=C4C=C3)OC)C)C)OC)C=CC=C2OC)OC |
| SMILES (Isomeric) | CC1=CC(=C2C(=C1C3=C(C4=C(N=C(C(=C4C=C3)OC)C)C)OC)C=CC=C2OC)OC |
| InChI | InChI=1S/C26H27NO4/c1-14-13-21(29-5)24-17(9-8-10-20(24)28-4)22(14)18-11-12-19-23(26(18)31-7)15(2)27-16(3)25(19)30-6/h8-13H,1-7H3 |
| InChI Key | MRGWVJULKVHKDF-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.19400834 g/mol |
| Topological Polar Surface Area (TPSA) | 49.80 Ų |
| XlogP | 6.00 |
| NSC656303 |
| CHEMBL2089377 |
| DTXSID801134862 |
| NSC-656303 |
| 146471-70-7 |
| 7-(4,5-Dimethoxy-2-methyl-1-naphthalenyl)-4,8-dimethoxy-1,3-dimethylisoquinoline |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 96.33% | 92.98% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.37% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.18% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.15% | 86.33% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 93.07% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.21% | 94.00% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 92.11% | 94.03% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 91.97% | 95.39% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.35% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.84% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.69% | 89.62% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.11% | 90.20% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.92% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.77% | 99.15% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.53% | 96.21% |
| CHEMBL2337 | P48067 | Glycine transporter 1 | 87.33% | 95.45% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 87.10% | 96.67% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.50% | 95.50% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 82.76% | 94.67% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 82.55% | 91.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.44% | 99.17% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.85% | 100.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.49% | 100.00% |
| CHEMBL5903 | Q04771 | Activin receptor type-1 | 81.29% | 89.93% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.10% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Triphyophyllum peltatum |
| PubChem | 375955 |
| LOTUS | LTS0264114 |
| wikiData | Q105170567 |