Dinophysistoxin 4
| Internal ID | 7f5ff0d4-aee2-4306-b094-a8d194cbaed7 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters |
| IUPAC Name | [(3E,5E)-7-[2-hydroxy-3-[11-hydroxy-2-[(E)-4-[4-hydroxy-2-[1-hydroxy-3-(3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl)butyl]-3-methylidenespiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-6,5'-oxolane]-2'-yl]but-3-en-2-yl]-4-methyl-1,7-dioxaspiro[5.5]undec-4-en-8-yl]-2-methylpropanoyl]oxy-6-methylhepta-3,5-dienyl] (E)-7,11,13-trihydroxy-9,12,14-trisulfooxytetradec-3-enoate |
| SMILES (Canonical) | CC1CCC2(CCCCO2)OC1C(C)CC(C3C(=C)C(C4C(O3)CCC5(O4)CCC(O5)C=CC(C)C6CC(=CC7(O6)C(CCC(O7)CC(C)(C(=O)OCC(=CC=CCCOC(=O)CC=CCCC(CC(CC(C(C(COS(=O)(=O)O)O)OS(=O)(=O)O)O)OS(=O)(=O)O)O)C)O)O)C)O)O |
| SMILES (Isomeric) | CC1CCC2(CCCCO2)OC1C(C)CC(C3C(=C)C(C4C(O3)CCC5(O4)CCC(O5)/C=C/C(C)C6CC(=CC7(O6)C(CCC(O7)CC(C)(C(=O)OC/C(=C/C=C/CCOC(=O)C/C=C/CCC(CC(CC(C(C(COS(=O)(=O)O)O)OS(=O)(=O)O)O)OS(=O)(=O)O)O)/C)O)O)C)O)O |
| InChI | InChI=1S/C66H104O30S3/c1-40(16-10-9-14-30-85-56(72)18-12-8-11-17-46(67)34-49(95-98(79,80)81)35-51(69)60(96-99(82,83)84)52(70)39-88-97(76,77)78)38-86-62(74)63(7,75)37-48-21-22-55(71)66(91-48)36-41(2)32-54(92-66)42(3)19-20-47-24-28-65(90-47)29-25-53-61(94-65)57(73)45(6)59(89-53)50(68)33-44(5)58-43(4)23-27-64(93-58)26-13-15-31-87-64/h8-10,12,16,19-20,36,42-44,46-55,57-61,67-71,73,75H,6,11,13-15,17-18,21-35,37-39H2,1-5,7H3,(H,76,77,78)(H,79,80,81)(H,82,83,84)/b10-9+,12-8+,20-19+,40-16+ |
| InChI Key | HGVSCTOLRDBUGU-YATGJHGASA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C66H104O30S3 |
| Molecular Weight | 1473.70 g/mol |
| Exact Mass | 1472.5774554 g/mol |
| Topological Polar Surface Area (TPSA) | 475.00 Ų |
| XlogP | 2.70 |
| Atomic LogP (AlogP) | 4.89 |
| H-Bond Acceptor | 27 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 34 |
| Dinophysistoxin-4 |
| Dtx-4 toxin |
| 162795-98-4 |
| RefChem:134474 |
| DTX-4 |
| C20005 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8805 | 88.05% |
| Caco-2 | - | 0.8586 | 85.86% |
| Blood Brain Barrier | + | 0.6500 | 65.00% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Mitochondria | 0.4828 | 48.28% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7959 | 79.59% |
| OATP1B3 inhibitior | + | 0.9329 | 93.29% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.8771 | 87.71% |
| BSEP inhibitior | + | 0.9777 | 97.77% |
| P-glycoprotein inhibitior | + | 0.7436 | 74.36% |
| P-glycoprotein substrate | + | 0.8471 | 84.71% |
| CYP3A4 substrate | + | 0.7632 | 76.32% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8793 | 87.93% |
| CYP3A4 inhibition | - | 0.8214 | 82.14% |
| CYP2C9 inhibition | - | 0.7722 | 77.22% |
| CYP2C19 inhibition | - | 0.7304 | 73.04% |
| CYP2D6 inhibition | - | 0.8745 | 87.45% |
| CYP1A2 inhibition | - | 0.7629 | 76.29% |
| CYP2C8 inhibition | + | 0.8621 | 86.21% |
| CYP inhibitory promiscuity | - | 0.8681 | 86.81% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.5800 | 58.00% |
| Carcinogenicity (trinary) | Non-required | 0.5547 | 55.47% |
| Eye corrosion | - | 0.9788 | 97.88% |
| Eye irritation | - | 0.8967 | 89.67% |
| Skin irritation | - | 0.7444 | 74.44% |
| Skin corrosion | - | 0.9122 | 91.22% |
| Ames mutagenesis | - | 0.5837 | 58.37% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7685 | 76.85% |
| Micronuclear | + | 0.5600 | 56.00% |
| Hepatotoxicity | + | 0.5783 | 57.83% |
| skin sensitisation | - | 0.8546 | 85.46% |
| Respiratory toxicity | + | 0.5333 | 53.33% |
| Reproductive toxicity | + | 0.9222 | 92.22% |
| Mitochondrial toxicity | + | 0.5875 | 58.75% |
| Nephrotoxicity | + | 0.5106 | 51.06% |
| Acute Oral Toxicity (c) | III | 0.5706 | 57.06% |
| Estrogen receptor binding | + | 0.6574 | 65.74% |
| Androgen receptor binding | + | 0.7720 | 77.20% |
| Thyroid receptor binding | + | 0.7115 | 71.15% |
| Glucocorticoid receptor binding | + | 0.7968 | 79.68% |
| Aromatase binding | + | 0.6980 | 69.80% |
| PPAR gamma | + | 0.8051 | 80.51% |
| Honey bee toxicity | - | 0.5956 | 59.56% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
| Fish aquatic toxicity | + | 0.9952 | 99.52% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 98.28% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.09% | 98.95% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 97.37% | 96.95% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 97.16% | 91.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.49% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.40% | 89.63% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.03% | 93.56% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 95.66% | 88.33% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 94.70% | 98.75% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.51% | 97.21% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 94.25% | 92.88% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.69% | 94.73% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.68% | 97.25% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 93.39% | 97.31% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 93.19% | 93.03% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.12% | 96.09% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 92.95% | 95.52% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.95% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.13% | 89.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.12% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.66% | 90.71% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 90.34% | 85.31% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.12% | 97.09% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 90.02% | 95.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.67% | 95.56% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 89.38% | 95.69% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.26% | 94.45% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.72% | 96.38% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 87.38% | 96.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.36% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.98% | 99.17% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 86.72% | 92.29% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.50% | 90.08% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.08% | 89.05% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.93% | 96.90% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.11% | 95.71% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 84.77% | 94.66% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.03% | 95.50% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 83.51% | 95.34% |
| CHEMBL5028 | O14672 | ADAM10 | 83.13% | 97.50% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.84% | 96.61% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 82.84% | 92.95% |
| CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 82.72% | 92.86% |
| CHEMBL238 | Q01959 | Dopamine transporter | 82.69% | 95.88% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.61% | 100.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 82.49% | 97.56% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 81.96% | 95.62% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.21% | 93.18% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.89% | 94.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.61% | 95.89% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.51% | 96.21% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.16% | 92.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.11% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6441267 |
| LOTUS | LTS0204205 |
| wikiData | Q105027993 |