Dinklacorine
Internal ID | b3b759a7-c7cb-4be2-ab3f-a719d519781b |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | (8S,21R)-13,27-dimethoxy-7,22-dimethyl-29,31-dioxa-7,22-diazaoctacyclo[19.9.3.14,30.110,14.115,19.03,8.025,33.028,32]hexatriaconta-1(30),2,4(34),10(36),11,13,15,17,19(35),25,27,32-dodecaen-16-ol |
SMILES (Canonical) | CN1CCC2=CC3=C4C=C2C1CC5=CC(=C(C=C5)OC)C6=C(C=CC(=C6)CC7C8=C(O4)C(=C(C=C8CCN7C)OC)O3)O |
SMILES (Isomeric) | CN1CCC2=CC3=C4C=C2[C@@H]1CC5=CC(=C(C=C5)OC)C6=C(C=CC(=C6)C[C@@H]7C8=C(O4)C(=C(C=C8CCN7C)OC)O3)O |
InChI | InChI=1S/C36H36N2O5/c1-37-11-9-22-17-31-32-19-24(22)27(37)15-21-6-8-30(40-3)26(14-21)25-13-20(5-7-29(25)39)16-28-34-23(10-12-38(28)2)18-33(41-4)35(42-31)36(34)43-32/h5-8,13-14,17-19,27-28,39H,9-12,15-16H2,1-4H3/t27-,28+/m0/s1 |
InChI Key | MMGBHVBJOIKWMF-WUFINQPMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H36N2O5 |
Molecular Weight | 576.70 g/mol |
Exact Mass | 576.26242225 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 6.10 |
60579-86-4 |
Dinklacorin |
(41R,412S)-16,46-dimethoxy-42,411-dimethyl-41,42,43,44,49,410,411,412-octahydro-4(1,12)-[1,4]dioxino[2,3-g:6,5-h']diisoquinolina-1,2(1,3)-dibenzenacyclopentaphan-26-ol |
O12-Demethyl-O12'-methyltiliacorine |
CHEMBL2262628 |
DTXSID70209381 |
AKOS040751587 |
Rodiasine, 6',7-didemethoxy-O12-demethyl-6',7-epoxy-O12'-methyl-, (1alpha,1'alpha)- |
(8S,21R)-13,27-dimethoxy-7,22-dimethyl-29,31-dioxa-7,22-diazaoctacyclo[19.9.3.14,30.110,14.115,19.03,8.025,33.028,32]hexatriaconta-1(30),2,4(34),10(36),11,13,15,17,19(35),25,27,32-dodecaen-16-ol |
![2D Structure of Dinklacorine 2D Structure of Dinklacorine](https://plantaedb.com/storage/docs/compounds/2023/11/dinklacorine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.46% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 96.02% | 95.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.55% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.19% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.19% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 93.87% | 98.95% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 93.73% | 91.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.01% | 91.11% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.61% | 89.62% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.55% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.25% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.75% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.44% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.41% | 89.00% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 87.27% | 90.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.09% | 94.00% |
CHEMBL2535 | P11166 | Glucose transporter | 86.05% | 98.75% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.84% | 82.38% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.40% | 90.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.72% | 95.78% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 84.50% | 80.78% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.89% | 96.38% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.87% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.68% | 92.94% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 81.17% | 96.86% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.49% | 95.53% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.05% | 82.67% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.03% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tiliacora dinklagei |
Tiliacora triandra |
PubChem | 181286 |
LOTUS | LTS0223865 |
wikiData | Q83083658 |