Dimethyl glutarate
| Internal ID | c9186f0c-7f6a-411e-85e1-331b39d0c792 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters > Fatty acid methyl esters |
| IUPAC Name | dimethyl pentanedioate |
| SMILES (Canonical) | COC(=O)CCCC(=O)OC |
| SMILES (Isomeric) | COC(=O)CCCC(=O)OC |
| InChI | InChI=1S/C7H12O4/c1-10-6(8)4-3-5-7(9)11-2/h3-5H2,1-2H3 |
| InChI Key | XTDYIOOONNVFMA-UHFFFAOYSA-N |
| Popularity | 151 references in papers |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 0.60 |
| 1119-40-0 |
| Glutaric acid dimethyl ester |
| Dimethyl pentanedioate |
| Pentanedioic acid, dimethyl ester |
| Glutaric acid, dimethyl ester |
| Pentanedioic acid, 1,5-dimethyl ester |
| DBE-5 dibasic ester |
| 1I9VFA346P |
| pentanedioic acid dimethyl ester |
| DTXSID3025122 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.37% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.23% | 99.17% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.04% | 94.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.02% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.17% | 83.82% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.02% | 96.95% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.66% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus trimestris |
| Scorzonera laciniata |
| PubChem | 14242 |
| LOTUS | LTS0211076 |
| wikiData | Q11074436 |