Dilinoleoyl-oleoyl-glycerol
| Internal ID | 7f8d5cc3-7611-433a-8053-bdadd7a0f2d1 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Long-chain fatty alcohols |
| IUPAC Name | (6Z,9Z,30Z)-19,20,21-trihydroxy-19-[(9Z,12Z)-octadeca-9,12-dienoyl]nonatriaconta-6,9,30-triene-18,22-dione |
| SMILES (Canonical) | CCCCCCCCC=CCCCCCCCC(=O)C(C(C(C(=O)CCCCCCCC=CCC=CCCCCC)(C(=O)CCCCCCCC=CCC=CCCCCC)O)O)O |
| SMILES (Isomeric) | CCCCCCCC/C=C\CCCCCCCC(=O)C(O)C(O)C(O)(C(=O)CCCCCCC/C=C\C/C=C\CCCCC)C(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C57H100O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52(58)55(61)56(62)57(63,53(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)54(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h17-18,20-21,25-30,55-56,61-63H,4-16,19,22-24,31-51H2,1-3H3/b20-17-,21-18-,28-25-,29-26-,30-27- |
| InChI Key | APPVUVFUSZRZMK-MVRVGECWSA-N |
| Popularity | 23 references in papers |
| Molecular Formula | C57H100O6 |
| Molecular Weight | 881.40 g/mol |
| Exact Mass | 880.75199091 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | 18.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 98.43% | 85.94% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.76% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.74% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.49% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.80% | 89.63% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.54% | 97.29% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.26% | 92.08% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 88.90% | 97.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.58% | 100.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.08% | 92.86% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.72% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.46% | 96.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.31% | 94.73% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.30% | 83.82% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.45% | 93.56% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.97% | 93.31% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 81.46% | 91.81% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.42% | 97.21% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.85% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Juglans regia |
| PubChem | 129724882 |
| LOTUS | LTS0030880 |
| wikiData | Q104916468 |