Dihydroumbellulone
| Internal ID | 5ba3ca0b-d93a-4e27-a17f-576ae16d6aa8 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
| IUPAC Name | 4-methyl-1-propan-2-ylbicyclo[3.1.0]hexan-2-one |
| SMILES (Canonical) | CC1CC(=O)C2(C1C2)C(C)C |
| SMILES (Isomeric) | CC1CC(=O)C2(C1C2)C(C)C |
| InChI | InChI=1S/C10H16O/c1-6(2)10-5-8(10)7(3)4-9(10)11/h6-8H,4-5H2,1-3H3 |
| InChI Key | HWBBMVBLJACLIN-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.23 g/mol |
| Exact Mass | 152.120115130 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 2.00 |
| (--)-Thujan-2-on |
| HWBBMVBLJACLIN-UHFFFAOYSA-N |
| 1-Isopropyl-4-methylbicyclo[3.1.0]hexan-2-one # |
| 4-methyl-1-(1-methylethyl)bicyclo[3.1.0]hexan-2-one |
| Bicyclo[3.1.0]hexan-2-one, 4-methyl-1-(1-methylethyl)-, (1.alpha.,4.beta.,5.alpha.)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.98% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.93% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.37% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.08% | 96.09% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.87% | 94.80% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.72% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.34% | 97.09% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 85.53% | 86.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.78% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.32% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.91% | 94.75% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.13% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.62% | 90.71% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.32% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Limnophila repens |
| PubChem | 565267 |
| LOTUS | LTS0164838 |
| wikiData | Q104253638 |