Dihydrotanshinone
Internal ID | b7146aba-5957-4c99-9150-1670b4b19111 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Tanshinones, isotanshinones, and derivatives |
IUPAC Name | 1,6-dimethyl-1,2-dihydronaphtho[1,2-g][1]benzofuran-10,11-dione |
SMILES (Canonical) | CC1COC2=C1C(=O)C(=O)C3=C2C=CC4=C(C=CC=C43)C |
SMILES (Isomeric) | CC1COC2=C1C(=O)C(=O)C3=C2C=CC4=C(C=CC=C43)C |
InChI | InChI=1S/C18H14O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)16(19)14-10(2)8-21-18(13)14/h3-7,10H,8H2,1-2H3 |
InChI Key | HARGZZNYNSYSGJ-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C18H14O3 |
Molecular Weight | 278.30 g/mol |
Exact Mass | 278.094294304 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 3.20 |
Atomic LogP (AlogP) | 3.29 |
H-Bond Acceptor | 3 |
H-Bond Donor | 0 |
Rotatable Bonds | 0 |
125623-97-4 |
CHEMBL1358724 |
1,6-dimethyl-1,2-dihydronaphtho[1,2-g][1]benzofuran-10,11-dione |
BSPBio_002470 |
SPECTRUM1505825 |
SCHEMBL5940466 |
BDBM50391428 |
AKOS015903073 |
CCG-214427 |
NCGC00095712-01 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | + | 0.9002 | 90.02% |
Blood Brain Barrier | + | 0.5678 | 56.78% |
Human oral bioavailability | + | 0.6714 | 67.14% |
Subcellular localzation | Mitochondria | 0.7877 | 78.77% |
OATP2B1 inhibitior | - | 0.8593 | 85.93% |
OATP1B1 inhibitior | + | 0.9413 | 94.13% |
OATP1B3 inhibitior | + | 0.9712 | 97.12% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | - | 0.9000 | 90.00% |
BSEP inhibitior | + | 0.6963 | 69.63% |
P-glycoprotein inhibitior | - | 0.6313 | 63.13% |
P-glycoprotein substrate | + | 0.5000 | 50.00% |
CYP3A4 substrate | + | 0.5955 | 59.55% |
CYP2C9 substrate | - | 0.8134 | 81.34% |
CYP2D6 substrate | - | 0.8183 | 81.83% |
CYP3A4 inhibition | - | 0.8310 | 83.10% |
CYP2C9 inhibition | + | 0.8163 | 81.63% |
CYP2C19 inhibition | + | 0.7145 | 71.45% |
CYP2D6 inhibition | - | 0.7503 | 75.03% |
CYP1A2 inhibition | + | 0.9385 | 93.85% |
CYP2C8 inhibition | - | 0.8299 | 82.99% |
CYP inhibitory promiscuity | + | 0.8855 | 88.55% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9543 | 95.43% |
Carcinogenicity (trinary) | Non-required | 0.5280 | 52.80% |
Eye corrosion | - | 0.9764 | 97.64% |
Eye irritation | - | 0.8367 | 83.67% |
Skin irritation | - | 0.7065 | 70.65% |
Skin corrosion | - | 0.9539 | 95.39% |
Ames mutagenesis | + | 0.5900 | 59.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5075 | 50.75% |
Micronuclear | + | 0.6600 | 66.00% |
Hepatotoxicity | + | 0.5524 | 55.24% |
skin sensitisation | + | 0.4773 | 47.73% |
Respiratory toxicity | + | 0.5222 | 52.22% |
Reproductive toxicity | + | 0.6444 | 64.44% |
Mitochondrial toxicity | + | 0.5375 | 53.75% |
Nephrotoxicity | - | 0.7592 | 75.92% |
Acute Oral Toxicity (c) | III | 0.4254 | 42.54% |
Estrogen receptor binding | + | 0.8206 | 82.06% |
Androgen receptor binding | + | 0.7474 | 74.74% |
Thyroid receptor binding | - | 0.6119 | 61.19% |
Glucocorticoid receptor binding | + | 0.6995 | 69.95% |
Aromatase binding | + | 0.5324 | 53.24% |
PPAR gamma | - | 0.4882 | 48.82% |
Honey bee toxicity | - | 0.9242 | 92.42% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5100 | 51.00% |
Fish aquatic toxicity | + | 0.9956 | 99.56% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
17782.8 nM |
Potency |
via CMAUP
|
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase |
398 nM |
Ki |
via Super-PRED
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
17782.8 nM |
Potency |
via CMAUP
|
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL1293237 | P54132 | Bloom syndrome protein |
28183.8 nM |
Potency |
via CMAUP
|
CHEMBL3180 | O00748 | Carboxylesterase 2 |
118 nM |
Ki |
via Super-PRED
|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
12589.3 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
15848.9 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
7943.3 nM 10000 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
22387.2 nM |
Potency |
via CMAUP
|
CHEMBL1947 | P10828 | Thyroid hormone receptor beta-1 |
44668.4 nM |
Potency |
via CMAUP
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
39810.7 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.50% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 97.49% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.10% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.11% | 91.49% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.86% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.73% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.19% | 94.73% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.79% | 94.80% |
CHEMBL1907 | P15144 | Aminopeptidase N | 86.65% | 93.31% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.61% | 92.98% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.26% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.14% | 86.33% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.86% | 96.00% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.30% | 93.65% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.78% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.85% | 96.00% |
CHEMBL4805 | Q99572 | P2X purinoceptor 7 | 80.58% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aquilaria sinensis |
Salvia digitaloides |
Salvia glutinosa |
Salvia miltiorrhiza |
Salvia prionitis |
Salvia przewalskii |
Salvia trijuga |
Salvia yunnanensis |
Veronicastrum sibiricum |
PubChem | 5316743 |
NPASS | NPC289432 |
ChEMBL | CHEMBL1358724 |
LOTUS | LTS0109215 |
wikiData | Q105025008 |