Dihydrocostunolide
| Internal ID | ba43be2c-35cf-4362-a976-3c4cd9dcd7a6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Germacranolides and derivatives |
| IUPAC Name | (6Z,10Z)-3,6,10-trimethyl-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2-one |
| SMILES (Canonical) | CC1C2CCC(=CCCC(=CC2OC1=O)C)C |
| SMILES (Isomeric) | CC1C2CC/C(=C\CC/C(=C\C2OC1=O)/C)/C |
| InChI | InChI=1S/C15H22O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h5,9,12-14H,4,6-8H2,1-3H3/b10-5-,11-9- |
| InChI Key | OVDMFKGCVWVONO-GYIATTAWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.161979940 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 2.90 |
| Cyclodeca(b)furan-2(3H)-one, 3a,4,5,8,9,11a-hexahydro-3,6,10-trimethyl-, (3S-(3R*,3aR*,6E,10E,11aS*))- |
| 2225-79-8 |
| Cyclodeca[b]furan-2(3H)-one, 3a,4,5,8,9,11a-hexahydro-3,6,10-trimethyl-, [3S-(3R*,3aR*,6E,10E,11aS*)]- |
| Costunolide, dihydro- |
| OVDMFKGCVWVONO-GYIATTAWSA-N |
| Germacra-1(10),4-dien-12-oic acid, 6.alpha.-hydroxy-, .gamma.-lactone, (E,E)-(11S)- |
| Cyclodeca[b]furan-2(3H)-one, 3a,4,5,8,9,11a-hexahydro-3,6,10-trimethyl-, [3S-(3R*,3aR*,6E,10E,11aR*)]- |
| 3,6,10-Trimethyl-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2(3H)-one # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.44% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.01% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.48% | 91.11% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.67% | 94.80% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 85.90% | 86.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.30% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.68% | 97.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.18% | 96.43% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.81% | 89.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.22% | 93.40% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.93% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Conocephalum japonicum |
| Coreocarpus arizonicus |
| Dolomiaea souliei |
| PubChem | 5367639 |
| LOTUS | LTS0223023 |
| wikiData | Q104402225 |