Dihydrobetulinic acid
Internal ID | 24eae96a-67b3-4c3f-8b56-bd38035e4537 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-propan-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
SMILES (Canonical) | CC(C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)C(=O)O |
SMILES (Isomeric) | CC(C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)C(=O)O |
InChI | InChI=1S/C30H50O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h18-24,31H,8-17H2,1-7H3,(H,32,33)/t19-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1 |
InChI Key | PZXJOHSZQAEJFE-FZFNOLFKSA-N |
Popularity | 8 references in papers |
Molecular Formula | C30H50O3 |
Molecular Weight | 458.70 g/mol |
Exact Mass | 458.37599545 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 8.30 |
25488-53-3 |
(3beta)-3-Hydroxylupan-28-oic acid |
20,29-dihydrobetulinic acid |
CHEMBL37 |
3-Hydroxylupan-28-oic acid |
(1S,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-propan-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
SCHEMBL3781854 |
CHEBI:65485 |
DTXSID40948376 |
PZXJOHSZQAEJFE-FZFNOLFKSA-N |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 97.78% | 96.38% |
CHEMBL204 | P00734 | Thrombin | 96.09% | 96.01% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.18% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.22% | 96.09% |
CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 89.04% | 91.83% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 89.00% | 85.31% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.78% | 92.98% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.72% | 91.19% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.53% | 90.71% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.71% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.69% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.42% | 95.56% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 83.93% | 96.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.04% | 93.03% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.61% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.53% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.42% | 92.86% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.00% | 94.75% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.49% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 81.01% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.64% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calophyllum inophyllum |
Chamaecyparis obtusa |
PubChem | 65319 |
LOTUS | LTS0154253 |
wikiData | Q105381236 |