Dihydro-5-(7-hydroxy-8-tetradecenyl)-2(3h)-furanone
| Internal ID | 0798cb57-96fa-411f-a303-20c842ffec79 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
| IUPAC Name | 5-(7-hydroxytetradec-8-enyl)oxolan-2-one |
| SMILES (Canonical) | CCCCCC=CC(CCCCCCC1CCC(=O)O1)O |
| SMILES (Isomeric) | CCCCCC=CC(CCCCCCC1CCC(=O)O1)O |
| InChI | InChI=1S/C18H32O3/c1-2-3-4-5-8-11-16(19)12-9-6-7-10-13-17-14-15-18(20)21-17/h8,11,16-17,19H,2-7,9-10,12-15H2,1H3 |
| InChI Key | RAXOXVFTKUDLED-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.23514488 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.56% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.57% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.59% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.88% | 89.63% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.25% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.08% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.90% | 93.56% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 88.82% | 98.03% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.70% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.58% | 95.56% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.06% | 97.29% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.03% | 96.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.08% | 97.79% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 87.08% | 96.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.81% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.57% | 96.47% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.77% | 91.81% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.03% | 92.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.57% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.35% | 94.73% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.98% | 82.38% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.73% | 92.08% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.43% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 75951471 |
| LOTUS | LTS0128464 |
| wikiData | Q105232948 |