Digoxigenin
Internal ID | 26ae823d-c434-46ee-8c9d-88ad843d681a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Cardenolides and derivatives |
IUPAC Name | 3-[(3S,5R,8R,9S,10S,12R,13S,14S,17R)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
SMILES (Canonical) | CC12CCC(CC1CCC3C2CC(C4(C3(CCC4C5=CC(=O)OC5)O)C)O)O |
SMILES (Isomeric) | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]3[C@@H]2C[C@H]([C@]4([C@@]3(CC[C@@H]4C5=CC(=O)OC5)O)C)O)O |
InChI | InChI=1S/C23H34O5/c1-21-7-5-15(24)10-14(21)3-4-17-18(21)11-19(25)22(2)16(6-8-23(17,22)27)13-9-20(26)28-12-13/h9,14-19,24-25,27H,3-8,10-12H2,1-2H3/t14-,15+,16-,17-,18+,19-,21+,22+,23+/m1/s1 |
InChI Key | SHIBSTMRCDJXLN-KCZCNTNESA-N |
Popularity | 10,238 references in papers |
Molecular Formula | C23H34O5 |
Molecular Weight | 390.50 g/mol |
Exact Mass | 390.24062418 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 1.10 |
Atomic LogP (AlogP) | 2.58 |
H-Bond Acceptor | 5 |
H-Bond Donor | 3 |
Rotatable Bonds | 1 |
1672-46-4 |
Lanadigenin |
Digoxigenine |
CHEBI:42098 |
HSDB 7108 |
NQ1SX9LNAU |
UNII-NQ1SX9LNAU |
EINECS 216-806-2 |
BRN 0096479 |
DTXSID6051778 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9875 | 98.75% |
Caco-2 | - | 0.5413 | 54.13% |
Blood Brain Barrier | - | 0.6189 | 61.89% |
Human oral bioavailability | - | 0.5286 | 52.86% |
Subcellular localzation | Mitochondria | 0.8004 | 80.04% |
OATP2B1 inhibitior | - | 0.7268 | 72.68% |
OATP1B1 inhibitior | + | 0.9350 | 93.50% |
OATP1B3 inhibitior | + | 0.9615 | 96.15% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.7493 | 74.93% |
BSEP inhibitior | + | 0.8186 | 81.86% |
P-glycoprotein inhibitior | - | 0.8715 | 87.15% |
P-glycoprotein substrate | + | 0.9249 | 92.49% |
CYP3A4 substrate | + | 0.6476 | 64.76% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.9060 | 90.60% |
CYP3A4 inhibition | - | 0.8310 | 83.10% |
CYP2C9 inhibition | - | 0.9099 | 90.99% |
CYP2C19 inhibition | - | 0.9256 | 92.56% |
CYP2D6 inhibition | - | 0.9362 | 93.62% |
CYP1A2 inhibition | - | 0.9046 | 90.46% |
CYP2C8 inhibition | - | 0.9460 | 94.60% |
CYP inhibitory promiscuity | - | 0.8702 | 87.02% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.5443 | 54.43% |
Eye corrosion | - | 0.9913 | 99.13% |
Eye irritation | - | 0.9557 | 95.57% |
Skin irritation | - | 0.5181 | 51.81% |
Skin corrosion | - | 0.9360 | 93.60% |
Ames mutagenesis | - | 0.5449 | 54.49% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4793 | 47.93% |
Micronuclear | - | 0.8400 | 84.00% |
Hepatotoxicity | - | 0.5123 | 51.23% |
skin sensitisation | - | 0.8828 | 88.28% |
Respiratory toxicity | + | 0.8778 | 87.78% |
Reproductive toxicity | + | 0.9222 | 92.22% |
Mitochondrial toxicity | + | 0.8750 | 87.50% |
Nephrotoxicity | - | 0.6568 | 65.68% |
Acute Oral Toxicity (c) | I | 0.5853 | 58.53% |
Estrogen receptor binding | + | 0.9076 | 90.76% |
Androgen receptor binding | + | 0.8387 | 83.87% |
Thyroid receptor binding | + | 0.5645 | 56.45% |
Glucocorticoid receptor binding | + | 0.8547 | 85.47% |
Aromatase binding | + | 0.7212 | 72.12% |
PPAR gamma | - | 0.5000 | 50.00% |
Honey bee toxicity | - | 0.8085 | 80.85% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | + | 0.5400 | 54.00% |
Fish aquatic toxicity | + | 0.9889 | 98.89% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
1995.3 nM 631 nM 631 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via Super-PRED |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
15.8 nM |
Potency |
via Super-PRED
|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
3981.1 nM |
Potency |
via CMAUP
|
CHEMBL2362980 | Q06710 | Paired box protein Pax-8 |
2350 nM |
AC50 |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
223.9 nM |
Potency |
via Super-PRED
|
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
2511.9 nM |
Potency |
via CMAUP
|
CHEMBL2073690 | Q6ZQN7 | Solute carrier organic anion transporter family member 4C1 |
490 nM |
IC50 |
PMID: 14993604
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
0.1 nM 0.1 nM |
Potency Potency |
via Super-PRED
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.01% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.08% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 95.07% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.59% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.04% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.63% | 97.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 89.38% | 96.43% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.97% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.98% | 96.77% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.73% | 93.04% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.21% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.91% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.51% | 86.33% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.62% | 91.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Digitalis lanata |
Digitalis purpurea |
PubChem | 15478 |
NPASS | NPC189588 |
ChEMBL | CHEMBL1153 |
LOTUS | LTS0074709 |
wikiData | Q420728 |