Diatretyne 2
| Internal ID | fa9d0461-ffcb-4de3-9a65-74ffda93b5a3 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Medium-chain fatty acids |
| IUPAC Name | (E)-7-cyanohept-2-en-4,6-diynoic acid |
| SMILES (Canonical) | C(=CC(=O)O)C#CC#CC#N |
| SMILES (Isomeric) | C(=C/C(=O)O)\C#CC#CC#N |
| InChI | InChI=1S/C8H3NO2/c9-7-5-3-1-2-4-6-8(10)11/h4,6H,(H,10,11)/b6-4+ |
| InChI Key | DMGKNZBGIHCAMP-GQCTYLIASA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C8H3NO2 |
| Molecular Weight | 145.11 g/mol |
| Exact Mass | 145.016378338 g/mol |
| Topological Polar Surface Area (TPSA) | 61.10 Ų |
| XlogP | 1.00 |
| Nudic acid B |
| Diatretynnitril |
| Diatretyne II |
| 463-15-0 |
| Diatretin 2 |
| 7-Cyano-trans-2-heptene-4,6-diynoic acid |
| 901HZ602ZX |
| (2E)-7-CYANOHEPT-2-EN-4,6-DIYNOIC ACID |
| 1402-35-3 |
| BRN 1703425 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6433188 |
| LOTUS | LTS0214101 |
| wikiData | Q27271268 |