6-[(1S,5S,6R)-6-[2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoyl]-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-2-(2,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one
| Internal ID | 1acbf116-4b19-43fa-86ae-8aabd6dc202c |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > 6-prenylated flavones |
| IUPAC Name | 6-[(1S,5S,6R)-6-[2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoyl]-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-2-(2,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| SMILES (Canonical) | CC1=CC(C(C(C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C(=C(C=C3)O)CC=C(C)C)O)C4=C(C5=C(C=C4O)OC(=CC5=O)C6=C(C=C(C=C6)O)O)O |
| SMILES (Isomeric) | CC1=C[C@@H]([C@@H]([C@H](C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C(=C(C=C3)O)CC=C(C)C)O)C4=C(C5=C(C=C4O)OC(=CC5=O)C6=C(C=C(C=C6)O)O)O |
| InChI | InChI=1S/C40H36O11/c1-18(2)4-7-24-28(43)11-10-25(38(24)48)39(49)35-26(22-8-5-20(41)14-29(22)44)12-19(3)13-27(35)36-31(46)17-34-37(40(36)50)32(47)16-33(51-34)23-9-6-21(42)15-30(23)45/h4-6,8-11,13-17,26-27,35,41-46,48,50H,7,12H2,1-3H3/t26-,27+,35-/m1/s1 |
| InChI Key | XBRYZRXERUJNCV-FHLNUDKKSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C40H36O11 |
| Molecular Weight | 692.70 g/mol |
| Exact Mass | 692.22576196 g/mol |
| Topological Polar Surface Area (TPSA) | 205.00 Ų |
| XlogP | 7.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.74% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.55% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.98% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.20% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.73% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.62% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.35% | 91.49% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.35% | 96.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.84% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.71% | 94.73% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 88.94% | 91.38% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 87.54% | 85.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.18% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.52% | 99.15% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.55% | 95.17% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.57% | 95.58% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.51% | 95.89% |
| CHEMBL3194 | P02766 | Transthyretin | 84.51% | 90.71% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.88% | 93.40% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.85% | 100.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 83.27% | 95.62% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.35% | 91.24% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 82.18% | 90.93% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.09% | 90.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.05% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.91% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.79% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.43% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Morus alba |
| PubChem | 57335177 |
| LOTUS | LTS0193135 |
| wikiData | Q105324648 |