Methyl 2-[14-(furan-3-yl)-11,17-dihydroxy-2,7,7,9,13-pentamethyl-6,16-dioxo-3,15-dioxapentacyclo[8.7.0.01,13.02,10.04,9]heptadec-4-en-8-yl]acetate
| Internal ID | 51d74978-c1b9-4cc7-8b21-99e251a387f0 |
| Taxonomy | Organoheterocyclic compounds > Lactones > Delta valerolactones |
| IUPAC Name | methyl 2-[14-(furan-3-yl)-11,17-dihydroxy-2,7,7,9,13-pentamethyl-6,16-dioxo-3,15-dioxapentacyclo[8.7.0.01,13.02,10.04,9]heptadec-4-en-8-yl]acetate |
| SMILES (Canonical) | CC1(C(C2(C(=CC1=O)OC3(C24C35C(C(=O)OC(C5(CC4O)C)C6=COC=C6)O)C)C)CC(=O)OC)C |
| SMILES (Isomeric) | CC1(C(C2(C(=CC1=O)OC3(C24C35C(C(=O)OC(C5(CC4O)C)C6=COC=C6)O)C)C)CC(=O)OC)C |
| InChI | InChI=1S/C27H32O9/c1-22(2)14(9-18(30)33-6)24(4)17(10-15(22)28)36-25(5)26(24)16(29)11-23(3)20(13-7-8-34-12-13)35-21(32)19(31)27(23,25)26/h7-8,10,12,14,16,19-20,29,31H,9,11H2,1-6H3 |
| InChI Key | FTFQECABUHFREG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H32O9 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.20463259 g/mol |
| Topological Polar Surface Area (TPSA) | 133.00 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.43% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.90% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.18% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.09% | 94.45% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 88.42% | 94.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.06% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.77% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.65% | 97.09% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.05% | 94.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.99% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.36% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hortia oreadica |
| PubChem | 163009714 |
| LOTUS | LTS0189483 |
| wikiData | Q104166756 |