[(4aR,5R,6R,8aS)-3,4a,5-trimethyl-9-oxo-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-6-yl] (2E,4E,6E)-5-methyldodeca-2,4,6-trienoate
| Internal ID | 56d97166-968f-45f8-a84a-5eee8697c1ff |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
| IUPAC Name | [(4aR,5R,6R,8aS)-3,4a,5-trimethyl-9-oxo-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-6-yl] (2E,4E,6E)-5-methyldodeca-2,4,6-trienoate |
| SMILES (Canonical) | CCCCCC=CC(=CC=CC(=O)OC1CCC2C(=O)C3=C(CC2(C1C)C)C(=CO3)C)C |
| SMILES (Isomeric) | CCCCC/C=C/C(=C/C=C/C(=O)O[C@@H]1CC[C@@H]2C(=O)C3=C(C[C@@]2([C@H]1C)C)C(=CO3)C)/C |
| InChI | InChI=1S/C28H38O4/c1-6-7-8-9-10-12-19(2)13-11-14-25(29)32-24-16-15-23-26(30)27-22(20(3)18-31-27)17-28(23,5)21(24)4/h10-14,18,21,23-24H,6-9,15-17H2,1-5H3/b12-10+,14-11+,19-13+/t21-,23+,24+,28+/m0/s1 |
| InChI Key | JWWIVKTYYNHIMX-FYPCQSJKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.27700969 g/mol |
| Topological Polar Surface Area (TPSA) | 56.50 Ų |
| XlogP | 8.10 |
| There are no found synonyms. |
![2D Structure of [(4aR,5R,6R,8aS)-3,4a,5-trimethyl-9-oxo-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-6-yl] (2E,4E,6E)-5-methyldodeca-2,4,6-trienoate](https://plantaedb.com/storage/docs/compounds/2023/11/df5c1260-85d0-11ee-9f93-e366d124a93a.jpg "2D Structure of [(4aR,5R,6R,8aS)-3,4a,5-trimethyl-9-oxo-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-6-yl] (2E,4E,6E)-5-methyldodeca-2,4,6-trienoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.08% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.81% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.40% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.13% | 90.17% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 90.91% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.78% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.86% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.94% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.92% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.90% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.61% | 93.56% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 85.17% | 85.94% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.32% | 94.80% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.84% | 95.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.97% | 94.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.46% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.69% | 92.50% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.27% | 97.28% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.25% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senecio glanduloso-pilosus |
| PubChem | 163186577 |
| LOTUS | LTS0057950 |
| wikiData | Q105136418 |