3,4,5-Trihydroxy-2-[[7,8,9,12,13,14,28,29,30,33,35-undecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-34-yl]oxy]benzoic acid
Internal ID | 45030d05-1070-4412-a0ba-ccbbeff5060f |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 3,4,5-trihydroxy-2-[[7,8,9,12,13,14,28,29,30,33,35-undecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-34-yl]oxy]benzoic acid |
SMILES (Canonical) | C1C2C(C3C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O1)O)O)O)O)OC9=C(C(=C(C=C9C(=O)O)O)O)O)O |
SMILES (Isomeric) | C1C2C(C3C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O1)O)O)O)O)OC9=C(C(=C(C=C9C(=O)O)O)O)O)O |
InChI | InChI=1S/C48H32O31/c49-15-1-9(2-16(50)27(15)56)43(68)79-48-41-40(77-46(71)11-4-18(52)29(58)33(62)24(11)25-12(47(72)78-41)5-19(53)30(59)34(25)63)39-22(74-48)8-73-44(69)10-3-17(51)28(57)32(61)23(10)26-13(45(70)76-39)6-21(55)38(35(26)64)75-37-14(42(66)67)7-20(54)31(60)36(37)65/h1-7,22,39-41,48-65H,8H2,(H,66,67) |
InChI Key | YISJQYWHGNZORC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H32O31 |
Molecular Weight | 1104.70 g/mol |
Exact Mass | 1104.09275422 g/mol |
Topological Polar Surface Area (TPSA) | 531.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.75% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 95.71% | 83.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.09% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.74% | 99.15% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 92.78% | 94.42% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.08% | 89.63% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.98% | 99.23% |
CHEMBL3194 | P02766 | Transthyretin | 91.55% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.46% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.12% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.86% | 94.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.07% | 97.21% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 87.09% | 96.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.54% | 95.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.94% | 96.95% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 85.71% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.93% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.85% | 91.19% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 82.66% | 100.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.99% | 95.50% |
CHEMBL2581 | P07339 | Cathepsin D | 81.91% | 98.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.28% | 96.21% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.77% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juglans regia |
PubChem | 162914924 |
LOTUS | LTS0215593 |
wikiData | Q105349017 |